Difference between revisions of "CPD-1301"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-08_002220 == * left end position: ** 2120645 * transcription direction: ** POSITIVE * right end position: ** 2123701 * centisome position: ** 31.6...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1301 CPD-1301] == * smiles: ** C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CC...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-08_002220 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1301 CPD-1301] ==
* left end position:
+
* smiles:
** 2120645
+
** C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=RXWVHRYZTWZATH-XSLAGTTESA-J
* right end position:
+
* common name:
** 2123701
+
** tetrahydropteroyl tri-L-glutamate
* centisome position:
+
* molecular weight:
** 31.665283    
+
** 699.633    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0007_0140
+
** H4PteGlu3
** Esi0007_0140
+
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-15556]]
+
== Reaction(s) known to produce the compound ==
** esiliculosus_genome
+
* [[RXN-12730]]
***automated-name-match
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[HOMOCYSMET-RXN]]
* [[PWY-7511]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=2120645}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791999 49791999]
{{#set: right end position=2123701}}
+
* CHEMSPIDER:
{{#set: centisome position=31.665283   }}
+
** [http://www.chemspider.com/Chemical-Structure.17625690.html 17625690]
{{#set: common name=Esi_0007_0140|Esi0007_0140}}
+
* CHEBI:
{{#set: reaction associated=RXN-15556}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58140 58140]
{{#set: pathway associated=PWY-7511}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C04144 C04144]
 +
* HMDB : HMDB12290
 +
{{#set: smiles=C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)}}
 +
{{#set: inchi key=InChIKey=RXWVHRYZTWZATH-XSLAGTTESA-J}}
 +
{{#set: common name=tetrahydropteroyl tri-L-glutamate}}
 +
{{#set: molecular weight=699.633   }}
 +
{{#set: common name=H4PteGlu3}}
 +
{{#set: produced by=RXN-12730}}
 +
{{#set: reversible reaction associated=HOMOCYSMET-RXN}}

Latest revision as of 19:01, 21 March 2018

Metabolite CPD-1301

  • smiles:
    • C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)
  • inchi key:
    • InChIKey=RXWVHRYZTWZATH-XSLAGTTESA-J
  • common name:
    • tetrahydropteroyl tri-L-glutamate
  • molecular weight:
    • 699.633
  • Synonym(s):
    • H4PteGlu3

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)" cannot be used as a page name in this wiki.