Difference between revisions of "RXN-12587"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-453 CPD1F-453] == * smiles: ** C1(C=C(O)C=CC=1C3(OC4(C=C([O-])C=C(O)C(C(=O)C(OC2(OC(CO)C(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12587 RXN-12587] == * direction: ** REVERSIBLE * common name: ** Aminotransferase class V domai...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-453 CPD1F-453] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12587 RXN-12587] ==
−
* smiles:
+
* direction:
−
** C1(C=C(O)C=CC=1C3(OC4(C=C([O-])C=C(O)C(C(=O)C(OC2(OC(CO)C(O)C(O)C(O)2))=3)=4)))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=JPUKWEQWGBDDQB-QSOFNFLRSA-M
+
 
* common name:
 
* common name:
−
** kaempferol-3-glucoside
+
** Aminotransferase class V domain
−
* molecular weight:
+
** Cysteine desulfurase
−
** 447.374   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.8.1.7 EC-2.8.1.7]
 
* Synonym(s):
 
* Synonym(s):
−
** kaempferol-3-O-D-glucoside
 
−
** kaempferol 3-O-β-D-glucoside
 
−
** astragalin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN1F-461]]
+
** 1 [[Unsulfurated-Sulfur-Acceptors]][c] '''+''' 1 [[L-Cysteine-Desulfurase-persulfide]][c] '''<=>''' 1 [[Cysteine-Desulfurase-L-cysteine]][c] '''+''' 1 [[Sulfurated-Sulfur-Acceptors]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 an unsulfurated [sulfur carrier][c] '''+''' 1 an [L-cysteine desulfurase] L-cysteine persulfide[c] '''<=>''' 1 an [L-cysteine desulfurase]-L-cysteine[c] '''+''' 1 a sulfurated [sulfur carrier][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-21_005640]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-21_003740]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-22_000950]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPK12111725
+
{{#set: direction=REVERSIBLE}}
−
* PUBCHEM:
+
{{#set: common name=Aminotransferase class V domain}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203515 25203515]
+
{{#set: common name=Cysteine desulfurase}}
−
* HMDB : HMDB37429
+
{{#set: ec number=EC-2.8.1.7}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Ec-21_005640|Ec-21_003740|Ec-22_000950}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C12249 C12249]
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30200 30200]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* METABOLIGHTS : MTBLC30200
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=C1(C=C(O)C=CC=1C3(OC4(C=C([O-])C=C(O)C(C(=O)C(OC2(OC(CO)C(O)C(O)C(O)2))=3)=4)))}}
+
−
{{#set: inchi key=InChIKey=JPUKWEQWGBDDQB-QSOFNFLRSA-M}}
+
−
{{#set: common name=kaempferol-3-glucoside}}
+
−
{{#set: molecular weight=447.374    }}
+
−
{{#set: common name=kaempferol-3-O-D-glucoside|kaempferol 3-O-&beta;-D-glucoside|astragalin}}
+
−
{{#set: produced by=RXN1F-461}}
+

Latest revision as of 19:21, 21 March 2018

Reaction RXN-12587

  • direction:
    • REVERSIBLE
  • common name:
    • Aminotransferase class V domain
    • Cysteine desulfurase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-12587&oldid=26377"