Difference between revisions of "CPD1F-453"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSAMINYL-ETCETERA-MANNOSYL-R GLUCOSAMINYL-ETCETERA-MANNOSYL-R] == * common name: ** (N-acet...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-453 CPD1F-453] == * smiles: ** C1(C=C(O)C=CC=1C3(OC4(C=C([O-])C=C(O)C(C(=O)C(OC2(OC(CO)C(...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-453 CPD1F-453] == |
+ | * smiles: | ||
+ | ** C1(C=C(O)C=CC=1C3(OC4(C=C([O-])C=C(O)C(C(=O)C(OC2(OC(CO)C(O)C(O)C(O)2))=3)=4))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=JPUKWEQWGBDDQB-QSOFNFLRSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** kaempferol-3-glucoside |
+ | * molecular weight: | ||
+ | ** 447.374 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** kaempferol-3-O-D-glucoside | ||
+ | ** kaempferol 3-O-β-D-glucoside | ||
+ | ** astragalin | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN1F-461]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: | + | * LIPID_MAPS : LMPK12111725 |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203515 25203515] | ||
+ | * HMDB : HMDB37429 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C12249 C12249] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30200 30200] | ||
+ | * METABOLIGHTS : MTBLC30200 | ||
+ | {{#set: smiles=C1(C=C(O)C=CC=1C3(OC4(C=C([O-])C=C(O)C(C(=O)C(OC2(OC(CO)C(O)C(O)C(O)2))=3)=4)))}} | ||
+ | {{#set: inchi key=InChIKey=JPUKWEQWGBDDQB-QSOFNFLRSA-M}} | ||
+ | {{#set: common name=kaempferol-3-glucoside}} | ||
+ | {{#set: molecular weight=447.374 }} | ||
+ | {{#set: common name=kaempferol-3-O-D-glucoside|kaempferol 3-O-β-D-glucoside|astragalin}} | ||
+ | {{#set: produced by=RXN1F-461}} |
Latest revision as of 19:22, 21 March 2018
Contents
Metabolite CPD1F-453
- smiles:
- C1(C=C(O)C=CC=1C3(OC4(C=C([O-])C=C(O)C(C(=O)C(OC2(OC(CO)C(O)C(O)C(O)2))=3)=4)))
- inchi key:
- InChIKey=JPUKWEQWGBDDQB-QSOFNFLRSA-M
- common name:
- kaempferol-3-glucoside
- molecular weight:
- 447.374
- Synonym(s):
- kaempferol-3-O-D-glucoside
- kaempferol 3-O-β-D-glucoside
- astragalin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIPID_MAPS : LMPK12111725
- PUBCHEM:
- HMDB : HMDB37429
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC30200
"C1(C=C(O)C=CC=1C3(OC4(C=C([O-])C=C(O)C(C(=O)C(OC2(OC(CO)C(O)C(O)C(O)2))=3)=4)))" cannot be used as a page name in this wiki.