Difference between revisions of "PWY-7723"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] == * smiles: ** C(=O)([O-])C(OP(=O)([O-])[O-])CO * inchi key: ** InChIKey=GXIURPTVHJ...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7723 PWY-7723] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-267890 TAX-...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7723 PWY-7723] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-267890 TAX-267890] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-543 TAX-543] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-641 TAX-641] |
* common name: | * common name: | ||
− | ** | + | ** bacterial bioluminescence |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''8''' reactions in the full pathway |
− | + | * [[RXN-9510]] | |
− | == Reaction(s) | + | ** 2 associated gene(s): |
− | * [[ | + | *** [[Ec-05_006330]] |
− | * [ | + | *** [[Ec-19_000340]] |
− | * [ | + | ** 1 reconstruction source(s) associated: |
− | * [ | + | *** [[annotation-esiliculosus_genome]] |
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=6.2.1.19-RXN 6.2.1.19-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=ALKANAL-MONOOXYGENASE-FMN-LINKED-RXN ALKANAL-MONOOXYGENASE-FMN-LINKED-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=FMNREDUCT-RXN FMNREDUCT-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12444 RXN-12444] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16395 RXN-16395] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17107 RXN-17107] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17108 RXN-17108] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-267890}} | |
− | + | {{#set: taxonomic range=TAX-543}} | |
− | + | {{#set: taxonomic range=TAX-641}} | |
− | + | {{#set: common name=bacterial bioluminescence}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=8}} | |
− | + | {{#set: completion rate=13.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:22, 21 March 2018
Pathway PWY-7723
- taxonomic range:
- common name:
- bacterial bioluminescence
- Synonym(s):
Reaction(s) found
1 reactions found over 8 reactions in the full pathway
- RXN-9510
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
- 6.2.1.19-RXN
- ALKANAL-MONOOXYGENASE-FMN-LINKED-RXN
- FMNREDUCT-RXN
- RXN-12444
- RXN-16395
- RXN-17107
- RXN-17108