Difference between revisions of "PWY-5901"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18085 CPD-18085] == * smiles: ** C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5901 PWY-5901] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18085 CPD-18085] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5901 PWY-5901] ==
* smiles:
+
* taxonomic range:
** C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))CC(=CC=5)C(=O)N)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=SNZSFAQYVLPEBZ-NNYOXOHSSA-J
+
 
* common name:
 
* common name:
** 1,2-dihydro-β-NADP
+
** 2,3-dihydroxybenzoate biosynthesis
* molecular weight:
+
** 741.394   
+
 
* Synonym(s):
 
* Synonym(s):
** 2-dihydro-nicotinamide adenine dinucleotide phosphate
 
** 2DHNADP
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''3''' reactions in the full pathway
* [[RXN-16765]]
+
* [[DHBDEHYD-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-01_004330]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[ISOCHORSYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-05_002520]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=ISOCHORMAT-RXN ISOCHORMAT-RXN]
 
== External links  ==
 
== External links  ==
{{#set: smiles=C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))CC(=CC=5)C(=O)N)}}
+
* ECOCYC:
{{#set: inchi key=InChIKey=SNZSFAQYVLPEBZ-NNYOXOHSSA-J}}
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5901 PWY-5901]
{{#set: common name=1,2-dihydro-β-NADP}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: molecular weight=741.394    }}
+
{{#set: common name=2,3-dihydroxybenzoate biosynthesis}}
{{#set: common name=2-dihydro-nicotinamide adenine dinucleotide phosphate|2DHNADP}}
+
{{#set: reaction found=2}}
{{#set: produced by=RXN-16765}}
+
{{#set: total reaction=3}}
 +
{{#set: completion rate=67.0}}

Latest revision as of 19:01, 21 March 2018

Pathway PWY-5901

  • taxonomic range:
  • common name:
    • 2,3-dihydroxybenzoate biosynthesis
  • Synonym(s):

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links