Difference between revisions of "RXN-961"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMP AMP] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])([O-])=O * inchi...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-961 RXN-961] == * direction: ** LEFT-TO-RIGHT * common name: ** D-ribulose-1,5-bisphosphate cle...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-961 RXN-961] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** D-ribulose-1,5-bisphosphate cleaving dioxygenase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.13.11 EC-1.13.11] |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** D-ribulose-1,5-bisphosphate oxygenase |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction | + | == Reaction Formula == |
− | * | + | * With identifiers: |
− | * | + | ** 1 [[D-RIBULOSE-15-P2]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CPD-67]][c] '''+''' 1 [[G3P]][c] '''+''' 2 [[PROTON]][c] |
− | * [[ | + | * With common name(s): |
− | + | ** 1 D-ribulose-1,5-bisphosphate[c] '''+''' 1 oxygen[c] '''=>''' 1 2-phosphoglycolate[c] '''+''' 1 3-phospho-D-glycerate[c] '''+''' 2 H+[c] | |
− | + | ||
− | + | == Genes associated with this reaction == | |
− | + | == Pathways == | |
− | + | * [[PWY-181]], photorespiration: [http://metacyc.org/META/NEW-IMAGE?object=PWY-181 PWY-181] | |
− | + | ** '''6''' reactions found over '''9''' reactions in the full pathway | |
− | + | == Reconstruction information == | |
− | + | * Category: [[gap-filling]] | |
− | + | ** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | |
− | + | *** Tool: [[meneco]] | |
− | + | **** Comment: [[added for gapfilling]] | |
− | * | + | |
− | * | + | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03140 R03140] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=D-ribulose-1,5-bisphosphate cleaving dioxygenase}} | |
− | + | {{#set: ec number=EC-1.13.11}} | |
− | + | {{#set: common name=D-ribulose-1,5-bisphosphate oxygenase}} | |
− | + | {{#set: in pathway=PWY-181}} | |
− | * LIGAND- | + | {{#set: reconstruction category=gap-filling}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}} |
− | + | {{#set: reconstruction tool=meneco}} | |
− | + | {{#set: reconstruction comment=added for gapfilling}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:22, 21 March 2018
Contents
Reaction RXN-961
- direction:
- LEFT-TO-RIGHT
- common name:
- D-ribulose-1,5-bisphosphate cleaving dioxygenase
- ec number:
- Synonym(s):
- D-ribulose-1,5-bisphosphate oxygenase
Reaction Formula
- With identifiers:
- 1 D-RIBULOSE-15-P2[c] + 1 OXYGEN-MOLECULE[c] => 1 CPD-67[c] + 1 G3P[c] + 2 PROTON[c]
- With common name(s):
- 1 D-ribulose-1,5-bisphosphate[c] + 1 oxygen[c] => 1 2-phosphoglycolate[c] + 1 3-phospho-D-glycerate[c] + 2 H+[c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: gap-filling
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
- Tool: meneco
- Comment: added for gapfilling
- Tool: meneco
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
External links
- LIGAND-RXN: