Difference between revisions of "PWY-7432"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-68 CPD-68] == * smiles: ** C([O-])(=O)C1(CC1)[N+] * inchi key: ** InChIKey=PAJPWUMXBYXFCZ-U...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7432 PWY-7432] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-68 CPD-68] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7432 PWY-7432] ==
* smiles:
+
* taxonomic range:
** C([O-])(=O)C1(CC1)[N+]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** InChIKey=PAJPWUMXBYXFCZ-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 1-aminocyclopropane-1-carboxylate
+
** L-phenylalanine biosynthesis III (cytosolic, plants)
* molecular weight:
+
** 101.105   
+
 
* Synonym(s):
 
* Synonym(s):
** 1-aminocyclopropane-1-carboxylic acid
 
** ACC
 
** 1-aminocyclopropanecarboxylic acid
 
** 1-aminocyclopropanecarboxylate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[4.1.99.4-RXN]]
+
'''4''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]]
* [[4.4.1.14-RXN]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-23_003630]]
* [[RXN-15149]]
+
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PHEAMINOTRANS-RXN]]
 +
** 6 associated gene(s):
 +
*** [[Ec-03_003270]]
 +
*** [[Ec-00_001230]]
 +
*** [[Ec-23_003500]]
 +
*** [[Ec-12_000850]]
 +
*** [[Ec-01_007480]]
 +
*** [[Ec-09_004540]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[PREPHENATEDEHYDRAT-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_003130]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-15200]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* CAS : 22059-21-8
+
{{#set: taxonomic range=TAX-33090}}
* PUBCHEM:
+
{{#set: common name=L-phenylalanine biosynthesis III (cytosolic, plants)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971063 6971063]
+
{{#set: reaction found=4}}
* HMDB : HMDB36458
+
{{#set: total reaction=4}}
* LIGAND-CPD:
+
{{#set: completion rate=100.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C01234 C01234]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58360 58360]
+
* METABOLIGHTS : MTBLC58360
+
{{#set: smiles=C([O-])(=O)C1(CC1)[N+]}}
+
{{#set: inchi key=InChIKey=PAJPWUMXBYXFCZ-UHFFFAOYSA-N}}
+
{{#set: common name=1-aminocyclopropane-1-carboxylate}}
+
{{#set: molecular weight=101.105    }}
+
{{#set: common name=1-aminocyclopropane-1-carboxylic acid|ACC|1-aminocyclopropanecarboxylic acid|1-aminocyclopropanecarboxylate}}
+
{{#set: consumed by=4.1.99.4-RXN}}
+
{{#set: produced by=4.4.1.14-RXN}}
+
{{#set: consumed or produced by=RXN-15149}}
+

Latest revision as of 19:22, 21 March 2018

Pathway PWY-7432

  • taxonomic range:
  • common name:
    • L-phenylalanine biosynthesis III (cytosolic, plants)
  • Synonym(s):

Reaction(s) found

4 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links