Difference between revisions of "Ec-04 004710"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSINE INOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-04_004710 == * left end position: ** 4759090 * transcription direction: ** NEGATIVE * right end position: ** 4766519 * centisome position: ** 73.0...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-04_004710 == |
− | * | + | * left end position: |
− | ** | + | ** 4759090 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4766519 |
− | * | + | * centisome position: |
− | ** | + | ** 73.08352 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0037_0138 |
− | ** | + | ** Esi0037_0138 |
− | ** | + | ** FBP |
− | == | + | == Reactions associated == |
− | + | * Reaction: [[F16BDEPHOS-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | ** Source: [[orthology-aragem]] |
− | * [[ | + | ** Source: [[orthology-aragem]] |
+ | * Reaction: [[SEDOHEPTULOSE-BISPHOSPHATASE-RXN]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways associated == | ||
+ | * [[GLUCONEO-PWY]] | ||
+ | * [[SUCSYN-PWY]] | ||
+ | * [[GLYCOLYSIS]] | ||
+ | * [[CALVIN-PWY]] | ||
+ | * [[PWY-5484]] | ||
+ | * [[P185-PWY]] | ||
+ | * [[PWY66-399]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4759090}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4766519}} | |
− | + | {{#set: centisome position=73.08352 }} | |
− | + | {{#set: common name=Esi_0037_0138|Esi0037_0138|FBP}} | |
− | + | {{#set: reaction associated=F16BDEPHOS-RXN|SEDOHEPTULOSE-BISPHOSPHATASE-RXN}} | |
− | + | {{#set: pathway associated=GLUCONEO-PWY|SUCSYN-PWY|GLYCOLYSIS|CALVIN-PWY|PWY-5484|P185-PWY|PWY66-399}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:23, 21 March 2018
Gene Ec-04_004710
- left end position:
- 4759090
- transcription direction:
- NEGATIVE
- right end position:
- 4766519
- centisome position:
- 73.08352
- Synonym(s):
- Esi_0037_0138
- Esi0037_0138
- FBP
Reactions associated
- Reaction: F16BDEPHOS-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: orthology-aragem
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
- Reaction: SEDOHEPTULOSE-BISPHOSPHATASE-RXN
- Source: orthology-aragem
- Source: orthology-aragem