Difference between revisions of "CPD-4581"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-02_002970 == * left end position: ** 3226604 * transcription direction: ** POSITIVE * right end position: ** 3234584 * centisome position: ** 49.4...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4581 CPD-4581] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4581 CPD-4581] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34)))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N |
| − | * | + | * common name: |
| − | ** | + | ** 5α-cholesta-8,24-dien-3-one |
| − | * | + | * molecular weight: |
| − | ** | + | ** 382.628 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN66-318]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298942 22298942] | |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52386 52386] |
| − | {{#set: common name= | + | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N}} |
| − | {{#set: | + | {{#set: common name=5α-cholesta-8,24-dien-3-one}} |
| + | {{#set: molecular weight=382.628 }} | ||
| + | {{#set: produced by=RXN66-318}} | ||
Latest revision as of 20:01, 21 March 2018
Contents
Metabolite CPD-4581
- smiles:
- CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))
- inchi key:
- InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N
- common name:
- 5α-cholesta-8,24-dien-3-one
- molecular weight:
- 382.628
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.
