Difference between revisions of "CPD-7214"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-649 CPD-649] == * smiles: ** CCCCCCCCCCCCCCCC(C(COP([O-])(=O)[O-])[N+])O * inchi key: ** In...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7214 CPD-7214] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3O)O)O) * i...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7214 CPD-7214] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3O)O)O) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=USQXPEWRYWRRJD-LBPRGKRZSA-M |
* common name: | * common name: | ||
| − | ** | + | ** (2S)-dihydrotricetin |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 303.248 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3',4',5'-pentahydroxyflavanone |
| − | ** | + | ** 5,7,3',4',5'-pentahydroxyflavanone |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-7922]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658763 90658763] |
| − | * | + | * CHEBI: |
| − | {{#set: smiles= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48026 48026] |
| − | {{#set: inchi key=InChIKey= | + | * METABOLIGHTS : MTBLC48026 |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: molecular weight= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05911 C05911] |
| − | {{#set: common name= | + | {{#set: smiles=C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3O)O)O)}} |
| − | {{#set: consumed by= | + | {{#set: inchi key=InChIKey=USQXPEWRYWRRJD-LBPRGKRZSA-M}} |
| + | {{#set: common name=(2S)-dihydrotricetin}} | ||
| + | {{#set: molecular weight=303.248 }} | ||
| + | {{#set: common name=3',4',5'-pentahydroxyflavanone|5,7,3',4',5'-pentahydroxyflavanone}} | ||
| + | {{#set: consumed by=RXN-7922}} | ||
Latest revision as of 19:23, 21 March 2018
Contents
Metabolite CPD-7214
- smiles:
- C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3O)O)O)
- inchi key:
- InChIKey=USQXPEWRYWRRJD-LBPRGKRZSA-M
- common name:
- (2S)-dihydrotricetin
- molecular weight:
- 303.248
- Synonym(s):
- 3',4',5'-pentahydroxyflavanone
- 5,7,3',4',5'-pentahydroxyflavanone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3O)O)O)" cannot be used as a page name in this wiki.
