Difference between revisions of "PWY-7377"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-DEHYDRO-SHIKIMATE 3-DEHYDRO-SHIKIMATE] == * smiles: ** C([O-])(=O)C1(=CC(=O)C(O)C(O)C1) * inc...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7377 PWY-7377] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7377 PWY-7377] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** cob(II)yrinate a,c-diamide biosynthesis I (early cobalt insertion) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''3''' reactions found over '''15''' reactions in the full pathway |
− | == Reaction(s) | + | * [[4.99.1.3-RXN]] |
− | * [[RXN- | + | ** 1 associated gene(s): |
− | == | + | *** [[Ec-10_002430]] |
− | * [[ | + | ** 1 reconstruction source(s) associated: |
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-8675]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-06_004170]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[UROPORIIIMETHYLTRANSA-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-06_004170]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.151-RXN 2.1.1.151-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=DIMETHUROPORDEHYDROG-RXN DIMETHUROPORDEHYDROG-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14315 RXN-14315] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8761 RXN-8761] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8762 RXN-8762] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8763 RXN-8763] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8764 RXN-8764] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8765 RXN-8765] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8766 RXN-8766] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8767 RXN-8767] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8768 RXN-8768] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8769 RXN-8769] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=cob(II)yrinate a,c-diamide biosynthesis I (early cobalt insertion)}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=15}} | |
− | + | {{#set: completion rate=20.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:24, 21 March 2018
Pathway PWY-7377
- taxonomic range:
- common name:
- cob(II)yrinate a,c-diamide biosynthesis I (early cobalt insertion)
- Synonym(s):
Reaction(s) found
3 reactions found over 15 reactions in the full pathway
- 4.99.1.3-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-8675
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- UROPORIIIMETHYLTRANSA-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
- 2.1.1.151-RXN
- DIMETHUROPORDEHYDROG-RXN
- RXN-14315
- RXN-8761
- RXN-8762
- RXN-8763
- RXN-8764
- RXN-8765
- RXN-8766
- RXN-8767
- RXN-8768
- RXN-8769