Difference between revisions of "PWY-7377"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-DEHYDRO-SHIKIMATE 3-DEHYDRO-SHIKIMATE] == * smiles: ** C([O-])(=O)C1(=CC(=O)C(O)C(O)C1) * inc...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7377 PWY-7377] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-DEHYDRO-SHIKIMATE 3-DEHYDRO-SHIKIMATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7377 PWY-7377] ==
* smiles:
+
* taxonomic range:
** C([O-])(=O)C1(=CC(=O)C(O)C(O)C1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=SLWWJZMPHJJOPH-PHDIDXHHSA-M
+
 
* common name:
 
* common name:
** 3-dehydroshikimate
+
** cob(II)yrinate a,c-diamide biosynthesis I (early cobalt insertion)
* molecular weight:
+
** 171.129   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-dehydroshikimic acid
 
** 5-dehydroshikimic acid
 
** 5-dehydroshikimate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[SHIKIMATE-5-DEHYDROGENASE-RXN]]
+
'''3''' reactions found over '''15''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[4.99.1.3-RXN]]
* [[RXN-7968]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-10_002430]]
* [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]]
+
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-8675]]
 +
** 1 associated gene(s):
 +
*** [[Ec-06_004170]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[UROPORIIIMETHYLTRANSA-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-06_004170]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.151-RXN 2.1.1.151-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=DIMETHUROPORDEHYDROG-RXN DIMETHUROPORDEHYDROG-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14315 RXN-14315]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8761 RXN-8761]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8762 RXN-8762]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8763 RXN-8763]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8764 RXN-8764]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8765 RXN-8765]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8766 RXN-8766]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8767 RXN-8767]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8768 RXN-8768]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8769 RXN-8769]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2157}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460360 5460360]
+
{{#set: taxonomic range=TAX-2}}
* CHEMSPIDER:
+
{{#set: common name=cob(II)yrinate a,c-diamide biosynthesis I (early cobalt insertion)}}
** [http://www.chemspider.com/Chemical-Structure.4573915.html 4573915]
+
{{#set: reaction found=3}}
* CHEBI:
+
{{#set: total reaction=15}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16630 16630]
+
{{#set: completion rate=20.0}}
* BIGG : 40260
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C02637 C02637]
+
{{#set: smiles=C([O-])(=O)C1(=CC(=O)C(O)C(O)C1)}}
+
{{#set: inchi key=InChIKey=SLWWJZMPHJJOPH-PHDIDXHHSA-M}}
+
{{#set: common name=3-dehydroshikimate}}
+
{{#set: molecular weight=171.129    }}
+
{{#set: common name=3-dehydroshikimic acid|5-dehydroshikimic acid|5-dehydroshikimate}}
+
{{#set: consumed by=SHIKIMATE-5-DEHYDROGENASE-RXN}}
+
{{#set: produced by=RXN-7968}}
+
{{#set: consumed or produced by=3-DEHYDROQUINATE-DEHYDRATASE-RXN}}
+

Latest revision as of 19:24, 21 March 2018

Pathway PWY-7377

  • taxonomic range:
  • common name:
    • cob(II)yrinate a,c-diamide biosynthesis I (early cobalt insertion)
  • Synonym(s):

Reaction(s) found

3 reactions found over 15 reactions in the full pathway

Reaction(s) not found

External links