Difference between revisions of "SORBITOL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta11-3-hydroxymelissoyl-ACPs cis-delta11-3-hydroxymelissoyl-ACPs] == * common name: ** a...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SORBITOL SORBITOL] == * smiles: ** C(C(C(C(C(CO)O)O)O)O)O * inchi key: ** InChIKey=FBPFZTCFMRRE...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SORBITOL SORBITOL] == |
| + | * smiles: | ||
| + | ** C(C(C(C(C(CO)O)O)O)O)O | ||
| + | * inchi key: | ||
| + | ** InChIKey=FBPFZTCFMRRESA-JGWLITMVSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** D-sorbitol |
| + | * molecular weight: | ||
| + | ** 182.173 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** L-gulitol | ||
| + | ** D-glucitol | ||
| + | ** meglumine | ||
| + | ** iso-sorbide | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-7644]] | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 50-70-4 |
| − | {{#set: | + | * BIGG : 36018 |
| + | * DRUGBANK : DB01638 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5780 5780] | ||
| + | * HMDB : HMDB00247 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00794 C00794] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.5576.html 5576] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17924 17924] | ||
| + | * METABOLIGHTS : MTBLC17924 | ||
| + | {{#set: smiles=C(C(C(C(C(CO)O)O)O)O)O}} | ||
| + | {{#set: inchi key=InChIKey=FBPFZTCFMRRESA-JGWLITMVSA-N}} | ||
| + | {{#set: common name=D-sorbitol}} | ||
| + | {{#set: molecular weight=182.173 }} | ||
| + | {{#set: common name=L-gulitol|D-glucitol|meglumine|iso-sorbide}} | ||
| + | {{#set: reversible reaction associated=RXN-7644}} | ||
Latest revision as of 19:24, 21 March 2018
Contents
Metabolite SORBITOL
- smiles:
- C(C(C(C(C(CO)O)O)O)O)O
- inchi key:
- InChIKey=FBPFZTCFMRRESA-JGWLITMVSA-N
- common name:
- D-sorbitol
- molecular weight:
- 182.173
- Synonym(s):
- L-gulitol
- D-glucitol
- meglumine
- iso-sorbide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 50-70-4
- BIGG : 36018
- DRUGBANK : DB01638
- PUBCHEM:
- HMDB : HMDB00247
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC17924
