Difference between revisions of "RXN-8668"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13187 CPD-13187] == * smiles: ** CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8668 RXN-8668] == * direction: ** LEFT-TO-RIGHT * common name: ** peptide-methionine (S)-S-oxid...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13187 CPD-13187] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8668 RXN-8668] ==
−
* smiles:
+
* direction:
−
** CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)OC4(OC(C([O-])=O)=CC(O)C(O)4)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=JMDPLHPAGLYHCI-DPADXCMISA-M
+
 
* common name:
 
* common name:
−
** unsaturated gellan tetrasaccharide
+
** peptide-methionine (S)-S-oxide reductase
−
* molecular weight:
+
* ec number:
−
** 645.544   
+
** [http://enzyme.expasy.org/EC/1.8.4.11 EC-1.8.4.11]
 
* Synonym(s):
 
* Synonym(s):
−
** β-D-4-deoxy-Δ4,5-GlcAp-(1→4)-β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-β-D-Glcp
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-12270]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Red-Thioredoxin]][c] '''+''' 1 [[Protein-L-methionine-S-S-oxides]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[Ox-Thioredoxin]][c] '''+''' 1 [[Protein-L-methionine]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a reduced thioredoxin[c] '''+''' 1 a protein-L-methionine-(S)-S-oxide[c] '''=>''' 1 H2O[c] '''+''' 1 an oxidized thioredoxin[c] '''+''' 1 a [protein]-L-methionine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-05_003050]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-00_003370]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-03_000880]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-01_007800]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-06_007510]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940141 52940141]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14217 14217]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63254 63254]
+
** [http://www.genome.jp/dbget-bin/www_bget?R04120 R04120]
−
{{#set: smiles=CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)OC4(OC(C([O-])=O)=CC(O)C(O)4)))}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: inchi key=InChIKey=JMDPLHPAGLYHCI-DPADXCMISA-M}}
+
{{#set: common name=peptide-methionine (S)-S-oxide reductase}}
−
{{#set: common name=unsaturated gellan tetrasaccharide}}
+
{{#set: ec number=EC-1.8.4.11}}
−
{{#set: molecular weight=645.544    }}
+
{{#set: gene associated=Ec-05_003050|Ec-00_003370|Ec-03_000880|Ec-01_007800|Ec-06_007510}}
−
{{#set: common name=β-D-4-deoxy-Δ4,5-GlcAp-(1→4)-β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-β-D-Glcp}}
+
{{#set: in pathway=}}
−
{{#set: consumed by=RXN-12270}}
+
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:24, 21 March 2018

Reaction RXN-8668

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • peptide-methionine (S)-S-oxide reductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-8668&oldid=26688"