Difference between revisions of "RXN-12869"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOCHORISMATE ISOCHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C=CC=C(C1O)C([O-])=O) * inchi ke...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12869 RXN-12869] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12869 RXN-12869] == |
| − | + | * direction: | |
| − | + | ** LEFT-TO-RIGHT | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | == | + | ** 2 [[L-DEHYDRO-ASCORBATE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 2 [[PROTON]][c] '''+''' 2 [[CPD-13914]][c] |
| − | * [[ | + | * With common name(s): |
| + | ** 2 L-dehydro-ascorbate[c] '''+''' 1 oxygen[c] '''=>''' 2 H+[c] '''+''' 2 cyclic-2,3-O-oxalyl-L-threonate[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | * [[PWY-6960]], L-ascorbate degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6960 PWY-6960] | ||
| + | ** '''3''' reactions found over '''6''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: in pathway=PWY-6960}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 19:24, 21 March 2018
Contents
Reaction RXN-12869
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- 2 L-DEHYDRO-ASCORBATE[c] + 1 OXYGEN-MOLECULE[c] => 2 PROTON[c] + 2 CPD-13914[c]
- With common name(s):
- 2 L-dehydro-ascorbate[c] + 1 oxygen[c] => 2 H+[c] + 2 cyclic-2,3-O-oxalyl-L-threonate[c]
Genes associated with this reaction
Pathways
- PWY-6960, L-ascorbate degradation III: PWY-6960
- 3 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
