|
|
(2 intermediate revisions by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SUPEROX-DISMUT-RXN SUPEROX-DISMUT-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13694 CPD-13694] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** CC(CCC(O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67)))) |
| + | * inchi key: |
| + | ** InChIKey=LPAPCIXIEIQRQA-OQRFGCRRSA-J |
| * common name: | | * common name: |
− | ** disproportionate superoxide radical into hydrogen peroxide | + | ** 24-hydroxy-3-oxocholest-4-en-26-oyl-CoA |
− | ** copper/zinc superoxide dismutase
| + | * molecular weight: |
− | ** Manganese/iron superoxide dismutase, C-terminal
| + | ** 1176.114 |
− | ** Destroys superoxide radical to produce hydrogen peroxide
| + | |
− | ** Destroys Superoxide radical to produce hydrogen peroxide
| + | |
− | ** Manganese/iron superoxide dismutase, N-terminal
| + | |
− | ** manganese superoxide dismutase | + | |
− | * ec number:
| + | |
− | ** [http://enzyme.expasy.org/EC/1.15.1.1 EC-1.15.1.1] | + | |
| * Synonym(s): | | * Synonym(s): |
| + | ** cholest-4-en-24-ol-3-one-26-oyl-CoA |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN-12705]] |
− | ** 2 [[PROTON]][c] '''+''' 2 [[SUPER-OXIDE]][c] '''=>''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 2 H+[c] '''+''' 2 superoxide[c] '''=>''' 1 oxygen[c] '''+''' 1 hydrogen peroxide[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-05_000630]] | + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-25_000220]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-01_007760]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-01_003850]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-08_003590]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-00_002760]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-22_002450]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-04_002870]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | == Pathways == | + | |
− | * [[DETOX1-PWY-1]], reactive oxygen species degradation: [http://metacyc.org/META/NEW-IMAGE?object=DETOX1-PWY-1 DETOX1-PWY-1]
| + | |
− | ** '''5''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[PWY-6854]], ethylene biosynthesis III (microbes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6854 PWY-6854]
| + | |
− | ** '''3''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[DETOX1-PWY]], superoxide radicals degradation: [http://metacyc.org/META/NEW-IMAGE?object=DETOX1-PWY DETOX1-PWY]
| + | |
− | ** '''2''' reactions found over '''2''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[esiliculosus_genome]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20696 20696] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658714 90658714] |
− | * LIGAND-RXN:
| + | {{#set: smiles=CC(CCC(O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00275 R00275]
| + | {{#set: inchi key=InChIKey=LPAPCIXIEIQRQA-OQRFGCRRSA-J}} |
− | * UNIPROT:
| + | {{#set: common name=24-hydroxy-3-oxocholest-4-en-26-oyl-CoA}} |
− | ** [http://www.uniprot.org/uniprot/P11419 P11419]
| + | {{#set: molecular weight=1176.114 }} |
− | ** [http://www.uniprot.org/uniprot/P09670 P09670]
| + | {{#set: common name=cholest-4-en-24-ol-3-one-26-oyl-CoA}} |
− | ** [http://www.uniprot.org/uniprot/P09213 P09213]
| + | {{#set: consumed by=RXN-12705}} |
− | ** [http://www.uniprot.org/uniprot/P11428 P11428]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15453 P15453]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09737 P09737]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20379 P20379]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07509 P07509]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16026 P16026]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19666 P19666]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25841 P25841]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09738 P09738]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19665 P19665]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19685 P19685]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28755 P28755]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34107 P34107]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34697 P34697]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41979 P41979]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q08420 Q08420]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01137 Q01137]
| + | |
− | ** [http://www.uniprot.org/uniprot/P53652 P53652]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M4I8 Q7M4I8]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25842 P25842]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41980 P41980]
| + | |
− | ** [http://www.uniprot.org/uniprot/P53641 P53641]
| + | |
− | ** [http://www.uniprot.org/uniprot/P54375 P54375]
| + | |
− | ** [http://www.uniprot.org/uniprot/O67149 O67149]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Z9C4 Q9Z9C4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RU48 Q9RU48]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RUV2 Q9RUV2]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41978 P41978]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43725 P43725]
| + | |
− | ** [http://www.uniprot.org/uniprot/O35023 O35023]
| + | |
− | ** [http://www.uniprot.org/uniprot/O67470 O67470]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JUW9 Q9JUW9]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00442 P00442]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00449 P00449]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00445 P00445]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00447 P00447]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0AGD3 P0AGD3]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00448 P00448]
| + | |
− | ** [http://www.uniprot.org/uniprot/P61851 P61851]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00446 P00446]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00443 P00443]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09224 P09224]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00441 P00441]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08294 P08294]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04179 P04179]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24704 P24704]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24705 P24705]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04178 P04178]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11964 P11964]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27084 P27084]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09678 P09678]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07895 P07895]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22233 P22233]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07505 P07505]
| + | |
− | ** [http://www.uniprot.org/uniprot/P03946 P03946]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M137 Q7M137]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43312 P43312]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZKE6 Q9ZKE6]
| + | |
− | ** [http://www.uniprot.org/uniprot/P57005 P57005]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18868 P18868]
| + | |
− | ** [http://www.uniprot.org/uniprot/O66602 O66602]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZD15 Q9ZD15]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Y8H8 Q9Y8H8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59623 Q59623]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JZV6 Q9JZV6]
| + | |
− | ** [http://www.uniprot.org/uniprot/O84296 O84296]
| + | |
− | ** [http://www.uniprot.org/uniprot/P53640 P53640]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11796 P11796]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59081 Q59081]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24702 P24702]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59165 Q59165]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37369 P37369]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42821 P42821]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59307 Q59307]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59315 Q59315]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41976 P41976]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09671 P09671]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07632 P07632]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28764 P28764]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80293 P80293]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42683 Q42683]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31161 P31161]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59452 Q59452]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0AGD1 P0AGD1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59094 Q59094]
| + | |
− | ** [http://www.uniprot.org/uniprot/O30826 O30826]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34461 P34461]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27538 Q27538]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZWM8 Q9ZWM8]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08228 P08228]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27082 P27082]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31108 P31108]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M1R5 Q7M1R5]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28759 P28759]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8LEP0 Q8LEP0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M4X8 Q7M4X8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0X9 Q7M0X9]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22799 P22799]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M1U7 Q7M1U7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M236 Q7M236]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M1U6 Q7M1U6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M1U5 Q7M1U5]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09223 P09223]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10791 P10791]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10792 P10792]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43273 Q43273]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11418 P11418]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13926 P13926]
| + | |
− | ** [http://www.uniprot.org/uniprot/P61852 P61852]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13367 P13367]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23345 P23345]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14830 P14830]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15107 P15107]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23417 P23417]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17670 P17670]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24706 P24706]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28763 P28763]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24669 P24669]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24707 P24707]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28757 P28757]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28760 P28760]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28756 P28756]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28766 P28766]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28762 P28762]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q00637 Q00637]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28761 P28761]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28765 P28765]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28767 P28767]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28768 P28768]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28758 P28758]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M240 Q7M240]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M239 Q7M239]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M237 Q7M237]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M238 Q7M238]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80174 P80174]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09212 P09212]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q08713 Q08713]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33431 P33431]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35017 P35017]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q07796 Q07796]
| + | |
− | ** [http://www.uniprot.org/uniprot/P53639 P53639]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14831 P14831]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q07182 Q07182]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41981 P41981]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9R4U1 Q9R4U1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q60036 Q60036]
| + | |
− | ** [http://www.uniprot.org/uniprot/P53643 P53643]
| + | |
− | ** [http://www.uniprot.org/uniprot/P53644 P53644]
| + | |
− | ** [http://www.uniprot.org/uniprot/P53645 P53645]
| + | |
− | ** [http://www.uniprot.org/uniprot/P53646 P53646]
| + | |
− | ** [http://www.uniprot.org/uniprot/P53649 P53649]
| + | |
− | ** [http://www.uniprot.org/uniprot/P53647 P53647]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46728 P46728]
| + | |
− | ** [http://www.uniprot.org/uniprot/P53650 P53650]
| + | |
− | ** [http://www.uniprot.org/uniprot/P53648 P53648]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41977 P41977]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q64466 Q64466]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M235 Q7M235]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59433 Q59433]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A4J5 P0A4J5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59806 Q59806]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A4J6 P0A4J6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59434 Q59434]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43779 Q43779]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27740 Q27740]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27460 Q27460]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59519 Q59519]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80566 P80566]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93801 P93801]
| + | |
− | ** [http://www.uniprot.org/uniprot/P77968 P77968]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93407 P93407]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43008 Q43008]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43803 Q43803]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43121 Q43121]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21276 P21276]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q96123 Q96123]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q96185 Q96185]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q02610 Q02610]
| + | |
− | ** [http://www.uniprot.org/uniprot/O24400 O24400]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93606 P93606]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22373 O22373]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49066 O49066]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42684 Q42684]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65324 O65324]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65768 O65768]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42672 Q42672]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81233 O81233]
| + | |
− | ** [http://www.uniprot.org/uniprot/O23785 O23785]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42862 Q42862]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49044 O49044]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90023 Q90023]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9YMI3 Q9YMI3]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92400 O92400]
| + | |
− | ** [http://www.uniprot.org/uniprot/O51917 O51917]
| + | |
− | ** [http://www.uniprot.org/uniprot/P61502 P61502]
| + | |
− | ** [http://www.uniprot.org/uniprot/O08459 O08459]
| + | |
− | ** [http://www.uniprot.org/uniprot/O08461 O08461]
| + | |
− | ** [http://www.uniprot.org/uniprot/P53653 P53653]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9LYK8 Q9LYK8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q03302 Q03302]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q03300 Q03300]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q03301 Q03301]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UQX0 Q9UQX0]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81235 O81235]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SM64 Q9SM64]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9STB5 Q9STB5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9M532 Q9M532]
| + | |
− | ** [http://www.uniprot.org/uniprot/O82584 O82584]
| + | |
− | ** [http://www.uniprot.org/uniprot/O82519 O82519]
| + | |
− | ** [http://www.uniprot.org/uniprot/O78310 O78310]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81236 O81236]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81240 O81240]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}}
| + | |
− | {{#set: common name=disproportionate superoxide radical into hydrogen peroxide}} | + | |
− | {{#set: common name=copper/zinc superoxide dismutase}}
| + | |
− | {{#set: common name=Manganese/iron superoxide dismutase, C-terminal}} | + | |
− | {{#set: common name=Destroys superoxide radical to produce hydrogen peroxide}} | + | |
− | {{#set: common name=Destroys Superoxide radical to produce hydrogen peroxide}} | + | |
− | {{#set: common name=Manganese/iron superoxide dismutase, N-terminal}}
| + | |
− | {{#set: common name=manganese superoxide dismutase}}
| + | |
− | {{#set: ec number=EC-1.15.1.1}}
| + | |
− | {{#set: gene associated=Ec-05_000630|Ec-25_000220|Ec-01_007760|Ec-01_003850|Ec-08_003590|Ec-00_002760|Ec-22_002450|Ec-04_002870}}
| + | |
− | {{#set: in pathway=DETOX1-PWY-1|PWY-6854|DETOX1-PWY}} | + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=esiliculosus_genome}}
| + | |