Difference between revisions of "CPD-12017"

Latest revision as of 19:25, 21 March 2018

"CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dihydro-Lipoyl-Proteins Dihydro-Lipoyl-Proteins] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] ==
+* smiles:
+** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))
+* inchi key:
+** InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M
 * common name:
-** a [lipoyl-carrier protein] N6-dihydrolipoyl-L-lysine
+** N-acetyl-serotonin sulfate
+* molecular weight:
+** 297.305
 * Synonym(s):
-** an [enzyme] N6-(dihydrolipoyl)lysine
+** N-acetyl-5-hydroxytryptamine sulfate
 == Reaction(s) known to consume the compound ==
-* [[1.8.1.4-RXN]]
 == Reaction(s) known to produce the compound ==
+* [[RXN-11059]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-{{#set: common name=a [lipoyl-carrier protein] N6-dihydrolipoyl-L-lysine}}
+* PUBCHEM:
-{{#set: common name=an [enzyme] N6-(dihydrolipoyl)lysine}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479248 45479248]
-{{#set: consumed by=1.8.1.4-RXN}}
+* HMDB : HMDB60834
+{{#set: smiles=CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))}}
+{{#set: inchi key=InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M}}
+{{#set: common name=N-acetyl-serotonin sulfate}}
+{{#set: molecular weight=297.305    }}
+{{#set: common name=N-acetyl-5-hydroxytryptamine sulfate}}
+{{#set: produced by=RXN-11059}}