Difference between revisions of "METHACRYLYL-COA"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-19_000200 == * left end position: ** 242999 * transcription direction: ** POSITIVE * right end position: ** 268146 * centisome position: ** 4.0698...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHACRYLYL-COA METHACRYLYL-COA] == * smiles: ** C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHACRYLYL-COA METHACRYLYL-COA] == |
| − | * | + | * smiles: |
| − | ** | + | ** C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=NPALUEYCDZWBOV-NDZSKPAWSA-J |
| − | * | + | * common name: |
| − | ** | + | ** methylacrylyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 831.577 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** methacrylyl-CoA |
| − | ** | + | ** 2-methylprop-2-enoyl-CoA |
| + | ** methacrylyl-coenzyme A | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[MEPROPCOA-FAD-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | * [[METHYLACYLYLCOA-HYDROXY-RXN]] |
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 6008-91-9 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53262325 53262325] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62500 62500] |
| − | {{#set: reaction associated= | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C03460 C03460] | ||
| + | * HMDB : HMDB01011 | ||
| + | {{#set: smiles=C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C}} | ||
| + | {{#set: inchi key=InChIKey=NPALUEYCDZWBOV-NDZSKPAWSA-J}} | ||
| + | {{#set: common name=methylacrylyl-CoA}} | ||
| + | {{#set: molecular weight=831.577 }} | ||
| + | {{#set: common name=methacrylyl-CoA|2-methylprop-2-enoyl-CoA|methacrylyl-coenzyme A}} | ||
| + | {{#set: produced by=MEPROPCOA-FAD-RXN}} | ||
| + | {{#set: reversible reaction associated=METHYLACYLYLCOA-HYDROXY-RXN}} | ||
Latest revision as of 19:25, 21 March 2018
Contents
Metabolite METHACRYLYL-COA
- smiles:
- C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C
- inchi key:
- InChIKey=NPALUEYCDZWBOV-NDZSKPAWSA-J
- common name:
- methylacrylyl-CoA
- molecular weight:
- 831.577
- Synonym(s):
- methacrylyl-CoA
- 2-methylprop-2-enoyl-CoA
- methacrylyl-coenzyme A
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C" cannot be used as a page name in this wiki.
