Difference between revisions of "RXN-4021"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15436 CPD-15436] == * smiles: ** CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4021 RXN-4021] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15436 CPD-15436] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4021 RXN-4021] ==
−
* smiles:
+
* direction:
−
** CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=MRVDZOHJMLTLHJ-STFCKWFXSA-J
+
** [http://enzyme.expasy.org/EC/2.1.1.41 EC-2.1.1.41]
−
* common name:
+
−
** (5Z)-tetradecenoyl-CoA
+
−
* molecular weight:
+
−
** 971.845   
+
 
* Synonym(s):
 
* Synonym(s):
−
** cis-tetradec-5-enoyl-CoA
 
−
** 14:1 cis-5
 
−
** 14:1(n-9)
 
−
** (5Z)-tetradec-5-enoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-14576]]
+
* With identifiers:
−
* [[RXN-17783]]
+
** 1 [[CYCLOARTENOL]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[CPD-696]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 cycloartenol[c] '''+''' 1 S-adenosyl-L-methionine[c] '''=>''' 1 H+[c] '''+''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 24-methylenecycloartanol[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-27_003950]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-2541]], plant sterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2541 PWY-2541]
 +
** '''10''' reactions found over '''36''' reactions in the full pathway
 +
* [[PWY-7155]], 7-dehydroporiferasterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7155 PWY-7155]
 +
** '''4''' reactions found over '''10''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659071 90659071]
+
** [http://www.genome.jp/dbget-bin/www_bget?R07481 R07481]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84650 84650]
+
{{#set: ec number=EC-2.1.1.41}}
−
{{#set: smiles=CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: gene associated=Ec-27_003950}}
−
{{#set: inchi key=InChIKey=MRVDZOHJMLTLHJ-STFCKWFXSA-J}}
+
{{#set: in pathway=PWY-2541|PWY-7155}}
−
{{#set: common name=(5Z)-tetradecenoyl-CoA}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: molecular weight=971.845    }}
+
{{#set: reconstruction source=orthology-aragem}}
−
{{#set: common name=cis-tetradec-5-enoyl-CoA|14:1 cis-5|14:1(n-9)|(5Z)-tetradec-5-enoyl-CoA}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: consumed by=RXN-14576|RXN-17783}}
+

Latest revision as of 19:25, 21 March 2018

Reaction RXN-4021

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-2541, plant sterol biosynthesis: PWY-2541
    • 10 reactions found over 36 reactions in the full pathway
  • PWY-7155, 7-dehydroporiferasterol biosynthesis: PWY-7155
    • 4 reactions found over 10 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-4021&oldid=26834"