Difference between revisions of "RXN-1223"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] == * smiles: ** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2)) * inchi key: ** InCh...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1223 RXN-1223] == * direction: ** LEFT-TO-RIGHT * common name: ** UDP-sulfoquinovose synthase,...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1223 RXN-1223] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** UDP-sulfoquinovose synthase, plastid precursor |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.13.1.1 EC-3.13.1.1] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[PROTON]][c] '''+''' 1 [[SO3]][c] '''+''' 1 [[CPD-12575]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[UDP-SULFOQUINOVOSE]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 H+[c] '''+''' 1 sulfite[c] '''+''' 1 UDP-α-D-glucose[c] '''=>''' 1 H2O[c] '''+''' 1 UDP-α-D-sulfoquinovopyranose[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-15_003040]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways == | ||
+ | * [[PWYQT-4427]], sulfoquinovosyl diacylglycerol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4427 PWYQT-4427] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13197 13197] |
− | {{#set: | + | * LIGAND-RXN: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?R05775 R05775] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: common name=UDP-sulfoquinovose synthase, plastid precursor}} |
− | {{#set: | + | {{#set: ec number=EC-3.13.1.1}} |
− | {{#set: | + | {{#set: gene associated=Ec-15_003040}} |
− | {{#set: | + | {{#set: in pathway=PWYQT-4427}} |
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 19:26, 21 March 2018
Contents
Reaction RXN-1223
- direction:
- LEFT-TO-RIGHT
- common name:
- UDP-sulfoquinovose synthase, plastid precursor
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROTON[c] + 1 SO3[c] + 1 CPD-12575[c] => 1 WATER[c] + 1 UDP-SULFOQUINOVOSE[c]
- With common name(s):
- 1 H+[c] + 1 sulfite[c] + 1 UDP-α-D-glucose[c] => 1 H2O[c] + 1 UDP-α-D-sulfoquinovopyranose[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-15_003040
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
Pathways
- PWYQT-4427, sulfoquinovosyl diacylglycerol biosynthesis: PWYQT-4427
- 2 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links