Difference between revisions of "CPD-11555"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14326 RXN-14326] == * direction: ** LEFT-TO-RIGHT * common name: ** Diphthine synthase, putativ...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11555 CPD-11555] == * smiles: ** CC1(O)(CC(=O)C3(C(O1)=CC(O)=CC(CC2(OC(=O)C=C([O-])C=2))=3)...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14326 RXN-14326] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11555 CPD-11555] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC1(O)(CC(=O)C3(C(O1)=CC(O)=CC(CC2(OC(=O)C=C([O-])C=2))=3))
 +
* inchi key:
 +
** InChIKey=WFNZGUNBSCUXFX-UHFFFAOYSA-M
 
* common name:
 
* common name:
−
** Diphthine synthase, putative
+
** octoketide
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.1.1.98 EC-2.1.1.98]
+
** 317.274   
 
* Synonym(s):
 
* Synonym(s):
 +
** SEK4
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[2-3-CARBOXY-3-AMINOPROPYL-L-HISTIDINE]][c] '''+''' 3 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[DIPHTINE]][c] '''+''' 3 [[ADENOSYL-HOMO-CYS]][c] '''+''' 3 [[PROTON]][c]
+
* [[RXN-10734]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a 2-[(3S)-3-amino-3-carboxypropyl]-L-histidine-[translation elongation factor 2][c] '''+''' 3 S-adenosyl-L-methionine[c] '''=>''' 1 a diphthine-[translation elongation factor 2][c] '''+''' 3 S-adenosyl-L-homocysteine[c] '''+''' 3 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-21_006260]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6482]], diphthamide biosynthesis (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6482 PWY-6482]
+
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R10306 R10306]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237243 44237243]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CC1(O)(CC(=O)C3(C(O1)=CC(O)=CC(CC2(OC(=O)C=C([O-])C=2))=3))}}
−
{{#set: common name=Diphthine synthase, putative}}
+
{{#set: inchi key=InChIKey=WFNZGUNBSCUXFX-UHFFFAOYSA-M}}
−
{{#set: ec number=EC-2.1.1.98}}
+
{{#set: common name=octoketide}}
−
{{#set: gene associated=Ec-21_006260}}
+
{{#set: molecular weight=317.274    }}
−
{{#set: in pathway=PWY-6482}}
+
{{#set: common name=SEK4}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: produced by=RXN-10734}}
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Latest revision as of 19:26, 21 March 2018

Metabolite CPD-11555

  • smiles:
    • CC1(O)(CC(=O)C3(C(O1)=CC(O)=CC(CC2(OC(=O)C=C([O-])C=2))=3))
  • inchi key:
    • InChIKey=WFNZGUNBSCUXFX-UHFFFAOYSA-M
  • common name:
    • octoketide
  • molecular weight:
    • 317.274
  • Synonym(s):
    • SEK4

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC1(O)(CC(=O)C3(C(O1)=CC(O)=CC(CC2(OC(=O)C=C([O-])C=2))=3))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-11555&oldid=26861"