Difference between revisions of "CPD-8652"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-301 PWY66-301] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8652 CPD-8652] == * smiles: ** C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2)) * inchi key: ** InCh...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8652 CPD-8652] == |
− | * | + | * smiles: |
− | ** [ | + | ** C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2)) |
+ | * inchi key: | ||
+ | ** InChIKey=JDWYRSDDJVCWPB-LURJTMIESA-M | ||
* common name: | * common name: | ||
− | ** | + | ** leucodopachrome |
+ | * molecular weight: | ||
+ | ** 194.166 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** cyclo-dopa |
− | ** | + | ** 2-carboxy-2,3-dihydro-5,6-dihydroxyindole |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-11369]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[RXN-8483]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202233 25202233] |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05604 C05604] |
− | {{#set: | + | * HMDB : HMDB04067 |
+ | {{#set: smiles=C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))}} | ||
+ | {{#set: inchi key=InChIKey=JDWYRSDDJVCWPB-LURJTMIESA-M}} | ||
+ | {{#set: common name=leucodopachrome}} | ||
+ | {{#set: molecular weight=194.166 }} | ||
+ | {{#set: common name=cyclo-dopa|2-carboxy-2,3-dihydro-5,6-dihydroxyindole}} | ||
+ | {{#set: consumed by=RXN-11369}} | ||
+ | {{#set: produced by=RXN-8483}} |
Latest revision as of 19:26, 21 March 2018
Contents
Metabolite CPD-8652
- smiles:
- C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))
- inchi key:
- InChIKey=JDWYRSDDJVCWPB-LURJTMIESA-M
- common name:
- leucodopachrome
- molecular weight:
- 194.166
- Synonym(s):
- cyclo-dopa
- 2-carboxy-2,3-dihydro-5,6-dihydroxyindole
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))" cannot be used as a page name in this wiki.