Difference between revisions of "Ec-20 003500"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8652 CPD-8652] == * smiles: ** C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2)) * inchi key: ** InCh...")
 
(Created page with "Category:Gene == Gene Ec-20_003500 == * left end position: ** 3727932 * transcription direction: ** NEGATIVE * right end position: ** 3736491 * centisome position: ** 72.2...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8652 CPD-8652] ==
+
== Gene Ec-20_003500 ==
−
* smiles:
+
* left end position:
−
** C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))
+
** 3727932
−
* inchi key:
+
* transcription direction:
−
** InChIKey=JDWYRSDDJVCWPB-LURJTMIESA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** leucodopachrome
+
** 3736491
−
* molecular weight:
+
* centisome position:
−
** 194.166    
+
** 72.29689    
 
* Synonym(s):
 
* Synonym(s):
−
** cyclo-dopa
+
** Esi_0010_0019
−
** 2-carboxy-2,3-dihydro-5,6-dihydroxyindole
+
** Esi0010_0019
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-11369]]
+
* Reaction: [[RIBITOL-2-DEHYDROGENASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-8483]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[RIBITOLUTIL-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3727932}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202233 25202233]
+
{{#set: transcription direction=NEGATIVE}}
−
* LIGAND-CPD:
+
{{#set: right end position=3736491}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05604 C05604]
+
{{#set: centisome position=72.29689   }}
−
* HMDB : HMDB04067
+
{{#set: common name=Esi_0010_0019|Esi0010_0019}}
−
{{#set: smiles=C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))}}
+
{{#set: reaction associated=RIBITOL-2-DEHYDROGENASE-RXN}}
−
{{#set: inchi key=InChIKey=JDWYRSDDJVCWPB-LURJTMIESA-M}}
+
{{#set: pathway associated=RIBITOLUTIL-PWY}}
−
{{#set: common name=leucodopachrome}}
+
−
{{#set: molecular weight=194.166   }}
+
−
{{#set: common name=cyclo-dopa|2-carboxy-2,3-dihydro-5,6-dihydroxyindole}}
+
−
{{#set: consumed by=RXN-11369}}
+
−
{{#set: produced by=RXN-8483}}
+

Latest revision as of 20:26, 21 March 2018

Gene Ec-20_003500

  • left end position:
    • 3727932
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3736491
  • centisome position:
    • 72.29689
  • Synonym(s):
    • Esi_0010_0019
    • Esi0010_0019

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-20_003500&oldid=26903"