Difference between revisions of "Ec-06 009680"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-DIHYDROXYBENZOATE 2-3-DIHYDROXYBENZOATE] == * smiles: ** C(C1(=CC=CC(=C1O)O))([O-])=O * inc...") |
(Created page with "Category:Gene == Gene Ec-06_009680 == * left end position: ** 7474379 * transcription direction: ** POSITIVE * right end position: ** 7483429 * centisome position: ** 85.3...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-06_009680 == |
− | * | + | * left end position: |
− | ** | + | ** 7474379 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 7483429 |
− | * | + | * centisome position: |
− | ** | + | ** 85.3458 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0086_0072 |
− | ** | + | ** Esi0086_0072 |
− | ** | + | ** PUS |
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=7474379}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=7483429}} | |
− | + | {{#set: centisome position=85.3458 }} | |
− | + | {{#set: common name=Esi_0086_0072|Esi0086_0072|PUS}} | |
− | + | {{#set: reaction associated=TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:01, 21 March 2018
Gene Ec-06_009680
- left end position:
- 7474379
- transcription direction:
- POSITIVE
- right end position:
- 7483429
- centisome position:
- 85.3458
- Synonym(s):
- Esi_0086_0072
- Esi0086_0072
- PUS
Reactions associated
- Reaction: TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome