Difference between revisions of "Ec-21 003740"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE SQUALENE] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C * inchi key...") |
(Created page with "Category:Gene == Gene Ec-21_003740 == * left end position: ** 4732928 * transcription direction: ** POSITIVE * right end position: ** 4743041 * centisome position: ** 64.1...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-21_003740 == |
− | * | + | * left end position: |
− | ** | + | ** 4732928 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4743041 |
− | * | + | * centisome position: |
− | ** | + | ** 64.13078 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0072_0110 | ||
+ | ** Esi0072_0110 | ||
+ | ** NFS | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN-12587]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[RXN- | + | *** Assignment: ec-number |
− | * [[ | + | * Reaction: [[RXN-12588]] |
− | * [[RXN- | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: ec-number |
+ | * Reaction: [[RXN-14382]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-14384]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-14385]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-14386]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-15881]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-9787]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN0-308]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY0-1021]] | ||
+ | * [[PWY-6823]] | ||
+ | * [[PWY-7250]] | ||
+ | * [[PWY-6892]] | ||
+ | * [[PWY-6891]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4732928}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4743041}} | |
− | + | {{#set: centisome position=64.13078 }} | |
− | + | {{#set: common name=Esi_0072_0110|Esi0072_0110|NFS}} | |
− | + | {{#set: reaction associated=RXN-12587|RXN-12588|RXN-14382|RXN-14384|RXN-14385|RXN-14386|RXN-15881|RXN-9787|RXN0-308}} | |
− | + | {{#set: pathway associated=PWY0-1021|PWY-6823|PWY-7250|PWY-6892|PWY-6891}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:26, 21 March 2018
Gene Ec-21_003740
- left end position:
- 4732928
- transcription direction:
- POSITIVE
- right end position:
- 4743041
- centisome position:
- 64.13078
- Synonym(s):
- Esi_0072_0110
- Esi0072_0110
- NFS
Reactions associated
- Reaction: RXN-12587
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-12588
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-14382
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-14384
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-14385
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-14386
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-15881
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-9787
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN0-308
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome