Difference between revisions of "LEU"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATPPHOSPHORIBOSYLTRANS-RXN ATPPHOSPHORIBOSYLTRANS-RXN] == * direction: ** REVERSIBLE * common name:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEU LEU] == * smiles: ** CC(CC([N+])C([O-])=O)C * inchi key: ** InChIKey=ROHFNLRQFUQHCH-YFKPBYR...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEU LEU] == |
− | * | + | * smiles: |
− | ** | + | ** CC(CC([N+])C([O-])=O)C |
+ | * inchi key: | ||
+ | ** InChIKey=ROHFNLRQFUQHCH-YFKPBYRVSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** L-leucine |
− | * | + | * molecular weight: |
− | ** | + | ** 131.174 |
* Synonym(s): | * Synonym(s): | ||
+ | ** (2S)-α-2-amino-4-methylvaleric acid | ||
+ | ** L | ||
+ | ** leu | ||
+ | ** leucine | ||
+ | ** 2-amino-4-methylvaleric acid | ||
+ | ** (2S)-α-leucine | ||
+ | ** L-leu | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[LEUCINE--TRNA-LIGASE-RXN]] | |
− | + | * [[biomass_rxn]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | * [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]] | |
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | = | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * NCI: |
− | ** [http:// | + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=46709 46709] |
− | * | + | * CAS : 61-90-5 |
− | + | * BIGG : 33942 | |
− | * | + | * PUBCHEM: |
− | * | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7045798 7045798] |
− | ** [http:// | + | * HMDB : HMDB00687 |
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00123 C00123] | |
− | * | + | * CHEBI: |
− | * | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57427 57427] |
− | ** [http://www. | + | * METABOLIGHTS : MTBLC57427 |
− | * | + | {{#set: smiles=CC(CC([N+])C([O-])=O)C}} |
− | ** [http://www. | + | {{#set: inchi key=InChIKey=ROHFNLRQFUQHCH-YFKPBYRVSA-N}} |
− | + | {{#set: common name=L-leucine}} | |
− | + | {{#set: molecular weight=131.174 }} | |
− | * | + | {{#set: common name=(2S)-α-2-amino-4-methylvaleric acid|L|leu|leucine|2-amino-4-methylvaleric acid|(2S)-α-leucine|L-leu}} |
− | + | {{#set: consumed by=LEUCINE--TRNA-LIGASE-RXN|biomass_rxn}} | |
− | + | {{#set: reversible reaction associated=BRANCHED-CHAINAMINOTRANSFERLEU-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:26, 21 March 2018
Contents
Metabolite LEU
- smiles:
- CC(CC([N+])C([O-])=O)C
- inchi key:
- InChIKey=ROHFNLRQFUQHCH-YFKPBYRVSA-N
- common name:
- L-leucine
- molecular weight:
- 131.174
- Synonym(s):
- (2S)-α-2-amino-4-methylvaleric acid
- L
- leu
- leucine
- 2-amino-4-methylvaleric acid
- (2S)-α-leucine
- L-leu
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- NCI:
- CAS : 61-90-5
- BIGG : 33942
- PUBCHEM:
- HMDB : HMDB00687
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57427
"CC(CC([N+])C([O-])=O)C" cannot be used as a page name in this wiki.