Difference between revisions of "PWYQT-4429"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYLETHYLAMINE PHENYLETHYLAMINE] == * smiles: ** C([N+])CC1(=CC=CC=C1) * inchi key: ** InChIK...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4429 PWYQT-4429] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TA...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYLETHYLAMINE PHENYLETHYLAMINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4429 PWYQT-4429] ==
* smiles:
+
* taxonomic range:
** C([N+])CC1(=CC=CC=C1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
** InChIKey=BHHGXPLMPWCGHP-UHFFFAOYSA-O
+
 
* common name:
 
* common name:
** 2-phenylethylamine
+
** CO2 fixation into oxaloacetate (anaplerotic)
* molecular weight:
+
** 122.189   
+
 
* Synonym(s):
 
* Synonym(s):
** β-phenylethylamine
 
** phenylethylamine
 
** phenethylamine
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[AMINEPHEN-RXN]]
+
'''2''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[PEPCARBOX-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-28_003470]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN0-5224]]
 +
** 8 associated gene(s):
 +
*** [[Ec-03_001960]]
 +
*** [[Ec-10_002770]]
 +
*** [[Ec-06_004120]]
 +
*** [[Ec-05_001290]]
 +
*** [[Ec-27_005680]]
 +
*** [[Ec-07_004610]]
 +
*** [[Ec-22_001150]]
 +
*** [[Ec-16_004700]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* CAS : 64-04-0
+
{{#set: taxonomic range=TAX-2157}}
* BIGG : 45591
+
{{#set: taxonomic range=TAX-33090}}
* DRUGBANK : DB04325
+
{{#set: common name=CO2 fixation into oxaloacetate (anaplerotic)}}
* PUBCHEM:
+
{{#set: reaction found=2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=448751 448751]
+
{{#set: total reaction=2}}
* HMDB : HMDB12275
+
{{#set: completion rate=100.0}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C05332 C05332]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.395457.html 395457]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=225237 225237]
+
* METABOLIGHTS : MTBLC225237
+
{{#set: smiles=C([N+])CC1(=CC=CC=C1)}}
+
{{#set: inchi key=InChIKey=BHHGXPLMPWCGHP-UHFFFAOYSA-O}}
+
{{#set: common name=2-phenylethylamine}}
+
{{#set: molecular weight=122.189    }}
+
{{#set: common name=β-phenylethylamine|phenylethylamine|phenethylamine}}
+
{{#set: consumed by=AMINEPHEN-RXN}}
+

Latest revision as of 19:27, 21 March 2018

Pathway PWYQT-4429

  • taxonomic range:
  • common name:
    • CO2 fixation into oxaloacetate (anaplerotic)
  • Synonym(s):

Reaction(s) found

2 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links