Difference between revisions of "Ec-01 002780"

Latest revision as of 19:27, 21 March 2018

@@ Line 1: / Line 1: @@
-[[Category:Metabolite]]
+[[Category:Gene]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11674 CPD-11674] ==
+== Gene Ec-01_002780 ==
-* smiles:
-** C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2))
-* inchi key:
-** InChIKey=FOCUAJYUOXSNDS-UHFFFAOYSA-M
-* common name:
-** 5-hydroxytryptophol sulfate
-* molecular weight:
-** 256.253
 * Synonym(s):
-** 5-hydroxytryptophol sulphate
+** Esi_0003_0136
+** Esi0003_0136
-== Reaction(s) known to consume the compound ==
+== Reactions associated ==
-== Reaction(s) known to produce the compound ==
+* Reaction: [[TRANSALDOL-RXN]]
-* [[RXN-10782]]
+** Source: [[orthology-aragem]]
-== Reaction(s) of unknown directionality ==
+** Source: [[orthology-aragem]]
+== Pathways associated ==
+* [[P124-PWY]]
+* [[P185-PWY]]
+* [[PWY-5723]]
+* [[PWY-1861]]
+* [[NONOXIPENT-PWY]]
 == External links  ==
-* PUBCHEM:
+{{#set: common name=Esi_0003_0136|Esi0003_0136}}
-** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237265 44237265]
+{{#set: reaction associated=TRANSALDOL-RXN}}
-{{#set: smiles=C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2))}}
+{{#set: pathway associated=P124-PWY|P185-PWY|PWY-5723|PWY-1861|NONOXIPENT-PWY}}
-{{#set: inchi key=InChIKey=FOCUAJYUOXSNDS-UHFFFAOYSA-M}}
-{{#set: common name=5-hydroxytryptophol sulfate}}
-{{#set: molecular weight=256.253    }}
-{{#set: common name=5-hydroxytryptophol sulphate}}
-{{#set: produced by=RXN-10782}}