Difference between revisions of "PWY-7216"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BUTYRYL-COA BUTYRYL-COA] == * smiles: ** CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7216 PWY-7216] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BUTYRYL-COA BUTYRYL-COA] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7216 PWY-7216] ==
* smiles:
+
* taxonomic range:
** CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=CRFNGMNYKDXRTN-HDRJHVAISA-J
+
 
* common name:
 
* common name:
** butanoyl-CoA
+
** (R)- and (S)-3-hydroxybutanoate biosynthesis (engineered)
* molecular weight:
+
** 833.593   
+
 
* Synonym(s):
 
* Synonym(s):
** butyryl-CoA
+
** (R)- and (S)-3-hydroxybutyrate biosynthesis
** butyryl-coenzyme A
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-12565]]
+
'''2''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Ec-26_003940]]
 +
*** [[Ec-24_000870]]
 +
*** [[Ec-22_002850]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[RXN-11662]]
 +
** 2 associated gene(s):
 +
*** [[Ec-19_005290]]
 +
*** [[Ec-14_006530]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14251 RXN-14251]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14255 RXN-14255]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-5901 RXN-5901]
 
== External links  ==
 
== External links  ==
* UM-BBD-CPD : c0023
+
{{#set: taxonomic range=TAX-2}}
* CAS : 2140-48-9
+
{{#set: common name=(R)- and (S)-3-hydroxybutanoate biosynthesis (engineered)}}
* BIGG : 33988
+
{{#set: common name=(R)- and (S)-3-hydroxybutyrate biosynthesis}}
* PUBCHEM:
+
{{#set: reaction found=2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244513 25244513]
+
{{#set: total reaction=5}}
* HMDB : HMDB01088
+
{{#set: completion rate=40.0}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00136 C00136]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57371 57371]
+
* METABOLIGHTS : MTBLC57371
+
{{#set: smiles=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=CRFNGMNYKDXRTN-HDRJHVAISA-J}}
+
{{#set: common name=butanoyl-CoA}}
+
{{#set: molecular weight=833.593    }}
+
{{#set: common name=butyryl-CoA|butyryl-coenzyme A}}
+
{{#set: consumed by=RXN-12565}}
+

Latest revision as of 19:27, 21 March 2018

Pathway PWY-7216

  • taxonomic range:
  • common name:
    • (R)- and (S)-3-hydroxybutanoate biosynthesis (engineered)
  • Synonym(s):
    • (R)- and (S)-3-hydroxybutyrate biosynthesis

Reaction(s) found

2 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links