Difference between revisions of "CPD-16819"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Octanoyl-ACPs Octanoyl-ACPs] == * common name: ** an octanoyl-[acp] * Synonym(s): == Reaction(...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] == * smiles: ** CC1(C=CC(=CC=1)OS(=O)(=O)[O-]) * inchi key: ** InChIKey=WG...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Octanoyl-ACPs Octanoyl-ACPs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] ==
 +
* smiles:
 +
** CC1(C=CC(=CC=1)OS(=O)(=O)[O-])
 +
* inchi key:
 +
** InChIKey=WGNAKZGUSRVWRH-UHFFFAOYSA-M
 
* common name:
 
* common name:
** an octanoyl-[acp]
+
** 4-methylphenyl sulfate
 +
* molecular weight:
 +
** 187.19   
 
* Synonym(s):
 
* Synonym(s):
 +
** p-cresol sulfate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9651]]
 
* [[RXN-9527]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14973]]
 
* [[RXN-9659]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-15588]]
 
== External links  ==
 
== External links  ==
{{#set: common name=an octanoyl-[acp]}}
+
* PUBCHEM:
{{#set: consumed by=RXN-9651|RXN-9527}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4615422 4615422]
{{#set: produced by=RXN-14973|RXN-9659}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.3806481.html 3806481]
 +
* HMDB : HMDB11635
 +
{{#set: smiles=CC1(C=CC(=CC=1)OS(=O)(=O)[O-])}}
 +
{{#set: inchi key=InChIKey=WGNAKZGUSRVWRH-UHFFFAOYSA-M}}
 +
{{#set: common name=4-methylphenyl sulfate}}
 +
{{#set: molecular weight=187.19    }}
 +
{{#set: common name=p-cresol sulfate}}
 +
{{#set: reversible reaction associated=RXN-15588}}

Latest revision as of 18:59, 21 March 2018

Metabolite CPD-16819

  • smiles:
    • CC1(C=CC(=CC=1)OS(=O)(=O)[O-])
  • inchi key:
    • InChIKey=WGNAKZGUSRVWRH-UHFFFAOYSA-M
  • common name:
    • 4-methylphenyl sulfate
  • molecular weight:
    • 187.19
  • Synonym(s):
    • p-cresol sulfate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC1(C=CC(=CC=1)OS(=O)(=O)[O-])" cannot be used as a page name in this wiki.