Difference between revisions of "PWY-5743"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLN GLN] == * smiles: ** C(=O)(N)CCC([N+])C([O-])=O * inchi key: ** InChIKey=ZDXPYRJPNDTMRX-VKH...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5743 PWY-5743] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-200795 TAX-...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5743 PWY-5743] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-200795 TAX-200795] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 3-hydroxypropanoate cycle |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3-hydroxypropionate/malyl-CoA cycle |
− | + | ** 3-hydroxypropionate cycle | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | ** | + | |
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''3''' reactions found over '''11''' reactions in the full pathway |
− | * [[ | + | * [[ACETYL-COA-CARBOXYLTRANSFER-RXN]] |
− | * [[ | + | ** 7 associated gene(s): |
− | * [[ | + | *** [[Ec-19_003040]] |
− | * [[ | + | *** [[Ec-03_001890]] |
− | * [[ | + | *** [[Ec-14_002460]] |
− | * [[ | + | *** [[Ec-01_009720]] |
− | * [[ | + | *** [[Ec-01_010970]] |
− | * [[ | + | *** [[Ec-19_003230]] |
− | * [[ | + | *** [[Ec-20_002520]] |
− | * [[ | + | ** 2 reconstruction source(s) associated: |
− | * [[ | + | *** [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** [[orthology-aragem]] |
− | * [[ | + | * [[PROPIONYL-COA-CARBOXY-RXN]] |
− | * [[ | + | ** 1 associated gene(s): |
− | + | *** [[Ec-01_010970]] | |
− | * [[ | + | ** 1 reconstruction source(s) associated: |
− | == Reaction(s) | + | *** [[annotation-esiliculosus_genome]] |
− | * [[ | + | * [[RXN-6383]] |
− | * [[ | + | ** 2 associated gene(s): |
− | * [ | + | *** [[Ec-14_006530]] |
− | * [ | + | *** [[Ec-17_000320]] |
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=MALYL-COA-LYASE-RXN MALYL-COA-LYASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=METHYLMALONYL-COA-EPIM-RXN METHYLMALONYL-COA-EPIM-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=METHYLMALONYL-COA-MUT-RXN METHYLMALONYL-COA-MUT-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8963 RXN-8963] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8964 RXN-8964] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8974 RXN-8974] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9086 RXN-9086] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9087 RXN-9087] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-200795}} | |
− | + | {{#set: common name=3-hydroxypropanoate cycle}} | |
− | + | {{#set: common name=3-hydroxypropionate/malyl-CoA cycle|3-hydroxypropionate cycle}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=11}} | |
− | + | {{#set: completion rate=27.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:28, 21 March 2018
Pathway PWY-5743
- taxonomic range:
- common name:
- 3-hydroxypropanoate cycle
- Synonym(s):
- 3-hydroxypropionate/malyl-CoA cycle
- 3-hydroxypropionate cycle
Reaction(s) found
3 reactions found over 11 reactions in the full pathway
- ACETYL-COA-CARBOXYLTRANSFER-RXN
- 7 associated gene(s):
- 2 reconstruction source(s) associated:
- PROPIONYL-COA-CARBOXY-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-6383
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
- MALYL-COA-LYASE-RXN
- METHYLMALONYL-COA-EPIM-RXN
- METHYLMALONYL-COA-MUT-RXN
- RXN-8963
- RXN-8964
- RXN-8974
- RXN-9086
- RXN-9087