Difference between revisions of "RXN-13617"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] == * smiles: ** CC(=O)NC(CCSC)C([O-])=O * inchi key: ** InChIKey=XUYPXLNMD...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13617 RXN-13617] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13617 RXN-13617] ==
−
* smiles:
+
* direction:
−
** CC(=O)NC(CCSC)C([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M
+
** [http://enzyme.expasy.org/EC/2.3.1.16 EC-2.3.1.16]
−
* common name:
+
−
** N-α-acetyl-L-methionine
+
−
* molecular weight:
+
−
** 190.237   
+
 
* Synonym(s):
 
* Synonym(s):
−
** N-acetyl-L-methionine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN0-6948]]
+
** 1 [[CPD0-2123]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[CPD-196]][c] '''+''' 1 [[ACETYL-COA]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 3-oxodecanoyl-CoA[c] '''+''' 1 coenzyme A[c] '''=>''' 1 octanoyl-CoA[c] '''+''' 1 acetyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-26_003940]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-7094]], fatty acid salvage: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7094 PWY-7094]
 +
** '''4''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB01646
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31089 31089]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6991985 6991985]
+
* LIGAND-RXN:
−
* HMDB : HMDB11745
+
** [http://www.genome.jp/dbget-bin/www_bget?R03778 R03778]
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02712 C02712]
+
{{#set: ec number=EC-2.3.1.16}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Ec-26_003940}}
−
** [http://www.chemspider.com/Chemical-Structure.395338.html 395338]
+
{{#set: in pathway=PWY-7094}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71670 71670]
+
{{#set: reconstruction source=orthology-aragem}}
−
{{#set: smiles=CC(=O)NC(CCSC)C([O-])=O}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M}}
+
−
{{#set: common name=N-α-acetyl-L-methionine}}
+
−
{{#set: molecular weight=190.237    }}
+
−
{{#set: common name=N-acetyl-L-methionine}}
+
−
{{#set: produced by=RXN0-6948}}
+

Latest revision as of 19:28, 21 March 2018

Reaction RXN-13617

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 3-oxodecanoyl-CoA[c] + 1 coenzyme A[c] => 1 octanoyl-CoA[c] + 1 acetyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7094, fatty acid salvage: PWY-7094
    • 4 reactions found over 6 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-13617&oldid=27190"