Difference between revisions of "CPD-10277"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16139 RXN-16139] == * direction: ** LEFT-TO-RIGHT * common name: ** phospholipase A2 * ec numbe...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] == * smiles: ** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C * inchi key: ** InChIK...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16139 RXN-16139] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C
 +
* inchi key:
 +
** InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N
 
* common name:
 
* common name:
−
** phospholipase A2
+
** lotaustralin
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/3.1.1.4 EC-3.1.1.4]
+
** 261.274   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-9674]]
−
** 1 [[CPD-17282]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Glycerolipids]][c] '''+''' 1 [[5Z8Z11Z14Z17Z-EICOSAPENTAENOATE]][c] '''+''' 1 [[PROTON]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-13603]]
−
** 1 a [glycerolipid]-icosapentaenoate[c] '''+''' 1 H2O[c] '''=>''' 1 a glycerolipid[c] '''+''' 1 icosapentaenoate[c] '''+''' 1 H+[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-21_005150]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
* [[Ec-04_004650]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
== Pathways  ==
+
−
* [[PWY66-394]], aspirin triggered resolvin E biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-394 PWY66-394]
+
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=phospholipase A2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=441467 441467]
−
{{#set: ec number=EC-3.1.1.4}}
+
* CHEBI:
−
{{#set: gene associated=Ec-21_005150|Ec-04_004650}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6542 6542]
−
{{#set: in pathway=PWY66-394}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C08334 C08334]
−
{{#set: reconstruction tool=pathwaytools}}
+
* HMDB : HMDB33865
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: smiles=CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C}}
 +
{{#set: inchi key=InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N}}
 +
{{#set: common name=lotaustralin}}
 +
{{#set: molecular weight=261.274    }}
 +
{{#set: common name=2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside}}
 +
{{#set: consumed by=RXN-9674}}
 +
{{#set: produced by=RXN-13603}}

Latest revision as of 19:29, 21 March 2018

Metabolite CPD-10277

  • smiles:
    • CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C
  • inchi key:
    • InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N
  • common name:
    • lotaustralin
  • molecular weight:
    • 261.274
  • Synonym(s):
    • 2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-10277&oldid=27212"