Difference between revisions of "RXN-17016"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7526 CPD-7526] == * smiles: ** CC(=CCCC(=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17016 RXN-17016] == * direction: ** LEFT-TO-RIGHT * common name: ** Glycerol-3-phosphate O-acyl...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7526 CPD-7526] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17016 RXN-17016] ==
−
* smiles:
+
* direction:
−
** CC(=CCCC(=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=BIWLELKAFXRPDE-ZURBLSRNSA-N
+
 
* common name:
 
* common name:
−
** 9,9'-di-cis-ζ-carotene
+
** Glycerol-3-phosphate O-acyltransferase
−
* molecular weight:
+
* ec number:
−
** 540.914   
+
** [http://enzyme.expasy.org/EC/2.3.1.15 EC-2.3.1.15]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-11356]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Cis-vaccenoyl-ACPs]][c] '''+''' 1 [[GLYCEROL-3P]][c] '''=>''' 1 [[CPD-18348]][c] '''+''' 1 [[ACP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-12242]]
+
** 1 a cis-vaccenoyl-[acp][c] '''+''' 1 sn-glycerol 3-phosphate[c] '''=>''' 1 1-cis-vaccenoylglycerol-3-phosphate[c] '''+''' 1 a holo-[acyl-carrier protein][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-01_003960]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6440490 6440490]
+
{{#set: common name=Glycerol-3-phosphate O-acyltransferase}}
−
* CHEMSPIDER:
+
{{#set: ec number=EC-2.3.1.15}}
−
** [http://www.chemspider.com/Chemical-Structure.4944750.html 4944750]
+
{{#set: gene associated=Ec-01_003960}}
−
* CHEBI:
+
{{#set: in pathway=}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48716 48716]
+
{{#set: reconstruction category=annotation}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15857 C15857]
+
{{#set: reconstruction tool=pathwaytools}}
−
* HMDB : HMDB03063
+
−
{{#set: smiles=CC(=CCCC(=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C}}
+
−
{{#set: inchi key=InChIKey=BIWLELKAFXRPDE-ZURBLSRNSA-N}}
+
−
{{#set: common name=9,9'-di-cis-ζ-carotene}}
+
−
{{#set: molecular weight=540.914    }}
+
−
{{#set: consumed by=RXN-11356}}
+
−
{{#set: consumed or produced by=RXN-12242}}
+

Latest revision as of 19:29, 21 March 2018

Reaction RXN-17016

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Glycerol-3-phosphate O-acyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 a cis-vaccenoyl-[acp][c] + 1 sn-glycerol 3-phosphate[c] => 1 1-cis-vaccenoylglycerol-3-phosphate[c] + 1 a holo-[acyl-carrier protein][c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-17016&oldid=27232"