Difference between revisions of "Ec-05 001250"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] == * smiles: ** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1) * inchi key: ** InChIKey...")
 
(Created page with "Category:Gene == Gene Ec-05_001250 == * left end position: ** 2439615 * transcription direction: ** NEGATIVE * right end position: ** 2457446 * centisome position: ** 26.7...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] ==
+
== Gene Ec-05_001250 ==
−
* smiles:
+
* left end position:
−
** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)
+
** 2439615
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NKBSFRFTBUHMJF-UHFFFAOYSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** cyclic-2,3-O-oxalyl-L-threonate
+
** 2457446
−
* molecular weight:
+
* centisome position:
−
** 189.101    
+
** 26.798635    
 
* Synonym(s):
 
* Synonym(s):
−
** 2,3-cyclic oxalyl theronolactone
+
** Esi_0293_0005
 +
** Esi0293_0005
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12872]]
+
* Reaction: [[2.7.1.68-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-12869]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[PWY-6352]]
 +
* [[PWY-6351]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2439615}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659383 90659383]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)}}
+
{{#set: right end position=2457446}}
−
{{#set: inchi key=InChIKey=NKBSFRFTBUHMJF-UHFFFAOYSA-M}}
+
{{#set: centisome position=26.798635   }}
−
{{#set: common name=cyclic-2,3-O-oxalyl-L-threonate}}
+
{{#set: common name=Esi_0293_0005|Esi0293_0005}}
−
{{#set: molecular weight=189.101   }}
+
{{#set: reaction associated=2.7.1.68-RXN}}
−
{{#set: common name=2,3-cyclic oxalyl theronolactone}}
+
{{#set: pathway associated=PWY-6352|PWY-6351}}
−
{{#set: consumed by=RXN-12872}}
+
−
{{#set: produced by=RXN-12869}}
+

Latest revision as of 19:29, 21 March 2018

Gene Ec-05_001250

  • left end position:
    • 2439615
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2457446
  • centisome position:
    • 26.798635
  • Synonym(s):
    • Esi_0293_0005
    • Esi0293_0005

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-05_001250&oldid=27265"