Difference between revisions of "Ec-05 005680"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] == * smiles: ** C(=O)([O-])CCCCCCCC=...")
 
(Created page with "Category:Gene == Gene Ec-05_005680 == * left end position: ** 7549824 * transcription direction: ** NEGATIVE * right end position: ** 7561195 * centisome position: ** 82.9...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] ==
+
== Gene Ec-05_005680 ==
−
* smiles:
+
* left end position:
−
** C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]
+
** 7549824
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** α,ω-9Z-octadecenedioate
+
** 7561195
−
* molecular weight:
+
* centisome position:
−
** 310.433    
+
** 82.93317    
 
* Synonym(s):
 
* Synonym(s):
−
** α,ω-9Z-octadecenedioic acid
+
** Esi_0143_0027
−
** 1,18-9Z-octadecenedioic acid
+
** Esi0143_0027
−
** octadecenedioate
+
** LKHA4
−
** 18-carboxyl oleate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16418]]
+
* Reaction: [[LEUKOTRIENE-A4-HYDROLASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[PWY66-375]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=7549824}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657642 90657642]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]}}
+
{{#set: right end position=7561195}}
−
{{#set: inchi key=InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L}}
+
{{#set: centisome position=82.93317   }}
−
{{#set: common name=α,ω-9Z-octadecenedioate}}
+
{{#set: common name=Esi_0143_0027|Esi0143_0027|LKHA4}}
−
{{#set: molecular weight=310.433   }}
+
{{#set: reaction associated=LEUKOTRIENE-A4-HYDROLASE-RXN}}
−
{{#set: common name=α,ω-9Z-octadecenedioic acid|1,18-9Z-octadecenedioic acid|octadecenedioate|18-carboxyl oleate}}
+
{{#set: pathway associated=PWY66-375}}
−
{{#set: consumed by=RXN-16418}}
+

Latest revision as of 19:29, 21 March 2018

Gene Ec-05_005680

  • left end position:
    • 7549824
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 7561195
  • centisome position:
    • 82.93317
  • Synonym(s):
    • Esi_0143_0027
    • Esi0143_0027
    • LKHA4

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-05_005680&oldid=27283"