Difference between revisions of "Ec-26 002980"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENOL-PHENYLPYRUVATE ENOL-PHENYLPYRUVATE] == * smiles: ** C([O-])(=O)C(O)=CC1(C=CC=CC=1) * inchi...") |
(Created page with "Category:Gene == Gene Ec-26_002980 == * left end position: ** 3321732 * transcription direction: ** NEGATIVE * right end position: ** 3329533 * centisome position: ** 50.4...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-26_002980 == |
− | * | + | * left end position: |
− | ** | + | ** 3321732 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3329533 |
− | * | + | * centisome position: |
− | ** | + | ** 50.456577 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0104_0036 | ||
+ | ** Esi0104_0036 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[2.4.1.46-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN-16027]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-401]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3321732}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3329533}} | |
− | + | {{#set: centisome position=50.456577 }} | |
− | + | {{#set: common name=Esi_0104_0036|Esi0104_0036}} | |
− | + | {{#set: reaction associated=2.4.1.46-RXN|RXN-16027}} | |
− | + | {{#set: pathway associated=PWY-401}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:29, 21 March 2018
Gene Ec-26_002980
- left end position:
- 3321732
- transcription direction:
- NEGATIVE
- right end position:
- 3329533
- centisome position:
- 50.456577
- Synonym(s):
- Esi_0104_0036
- Esi0104_0036
Reactions associated
- Reaction: 2.4.1.46-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16027
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome