Difference between revisions of "CPD-12258"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=R2-2OH-Straight-Chain-234-Sat-FA-CoA R2-2OH-Straight-Chain-234-Sat-FA-CoA] == * common name: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12258 CPD-12258] == * smiles: ** CC(C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12258 CPD-12258] == |
| + | * smiles: | ||
| + | ** CC(C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)NC(=O)C(C)OC1(C(O)C(CO)OC(C(NC(=O)C)1)OP(OP(OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O)([O-])=O) | ||
| + | * inchi key: | ||
| + | ** InChIKey=FOEDSVRZGQIXSP-XSOIKTQOSA-K | ||
* common name: | * common name: | ||
| − | ** | + | ** UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanine |
| + | * molecular weight: | ||
| + | ** 1075.843 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** UDP-Mur2Ac(oyl-L-Ala-g-D-Glu-L-Lys-D-Ala) | ||
| + | ** UDP-MurNAc-tetrapeptide | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-11347]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658175 90658175] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C06432 C06432] | ||
| + | {{#set: smiles=CC(C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)NC(=O)C(C)OC1(C(O)C(CO)OC(C(NC(=O)C)1)OP(OP(OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O)([O-])=O)}} | ||
| + | {{#set: inchi key=InChIKey=FOEDSVRZGQIXSP-XSOIKTQOSA-K}} | ||
| + | {{#set: common name=UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanine}} | ||
| + | {{#set: molecular weight=1075.843 }} | ||
| + | {{#set: common name=UDP-Mur2Ac(oyl-L-Ala-g-D-Glu-L-Lys-D-Ala)|UDP-MurNAc-tetrapeptide}} | ||
| + | {{#set: consumed by=RXN-11347}} | ||
Latest revision as of 19:30, 21 March 2018
Contents
Metabolite CPD-12258
- smiles:
- CC(C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)NC(=O)C(C)OC1(C(O)C(CO)OC(C(NC(=O)C)1)OP(OP(OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O)([O-])=O)
- inchi key:
- InChIKey=FOEDSVRZGQIXSP-XSOIKTQOSA-K
- common name:
- UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanine
- molecular weight:
- 1075.843
- Synonym(s):
- UDP-Mur2Ac(oyl-L-Ala-g-D-Glu-L-Lys-D-Ala)
- UDP-MurNAc-tetrapeptide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)NC(=O)C(C)OC1(C(O)C(CO)OC(C(NC(=O)C)1)OP(OP(OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O)([O-])=O)" cannot be used as a page name in this wiki.
