Difference between revisions of "Beta-D-glucosides"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12258 CPD-12258] == * smiles: ** CC(C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-glucosides Beta-D-glucosides] == * common name: ** a β-D glucoside * Synonym(s): =...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12258 CPD-12258] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-glucosides Beta-D-glucosides] ==
* smiles:
+
** CC(C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)NC(=O)C(C)OC1(C(O)C(CO)OC(C(NC(=O)C)1)OP(OP(OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O)([O-])=O)
+
* inchi key:
+
** InChIKey=FOEDSVRZGQIXSP-XSOIKTQOSA-K
+
 
* common name:
 
* common name:
** UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanine
+
** a β-D glucoside
* molecular weight:
+
** 1075.843   
+
 
* Synonym(s):
 
* Synonym(s):
** UDP-Mur2Ac(oyl-L-Ala-g-D-Glu-L-Lys-D-Ala)
 
** UDP-MurNAc-tetrapeptide
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11347]]
+
* [[3.2.1.21-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a β-D glucoside}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658175 90658175]
+
{{#set: consumed by=3.2.1.21-RXN}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C06432 C06432]
+
{{#set: smiles=CC(C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)NC(=O)C(C)OC1(C(O)C(CO)OC(C(NC(=O)C)1)OP(OP(OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O)([O-])=O)}}
+
{{#set: inchi key=InChIKey=FOEDSVRZGQIXSP-XSOIKTQOSA-K}}
+
{{#set: common name=UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanine}}
+
{{#set: molecular weight=1075.843    }}
+
{{#set: common name=UDP-Mur2Ac(oyl-L-Ala-g-D-Glu-L-Lys-D-Ala)|UDP-MurNAc-tetrapeptide}}
+
{{#set: consumed by=RXN-11347}}
+

Latest revision as of 19:30, 21 March 2018

Metabolite Beta-D-glucosides

  • common name:
    • a β-D glucoside
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links