Difference between revisions of "Fatty-Acids"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Fatty-Acids Fatty-Acids] == * common name: ** a fatty acid * Synonym(s): == Reaction(s) known...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Fatty-Acids Fatty-Acids] ==
* smiles:
+
** CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J
+
 
* common name:
 
* common name:
** 3-oxo-(11Z)-octadecenoyl-CoA
+
** a fatty acid
* molecular weight:
+
** 1041.936   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-18:1-Δ11-CoA
 
** 3-oxo-11-cis-octadecenoyl-CoA
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17786]]
+
* [[CERAMIDASE-RXN]]
 +
* [[RXN-1602]]
 +
* [[RXN-11375]]
 +
* [[TRIACYLGLYCEROL-LIPASE-RXN]]
 +
* [[3.1.1.23-RXN]]
 +
* [[RXN0-6725]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=a fatty acid}}
{{#set: inchi key=InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J}}
+
{{#set: produced by=CERAMIDASE-RXN|RXN-1602|RXN-11375|TRIACYLGLYCEROL-LIPASE-RXN|3.1.1.23-RXN|RXN0-6725}}
{{#set: common name=3-oxo-(11Z)-octadecenoyl-CoA}}
+
{{#set: molecular weight=1041.936    }}
+
{{#set: common name=3-oxo-18:1-Δ11-CoA|3-oxo-11-cis-octadecenoyl-CoA}}
+
{{#set: produced by=RXN-17786}}
+

Latest revision as of 19:02, 21 March 2018

Metabolite Fatty-Acids

  • common name:
    • a fatty acid
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links