Difference between revisions of "CPD-7015"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_ADENOSYLCOBALAMIN ExchangeSeed_ADENOSYLCOBALAMIN] == * direction: ** REVERSIBLE * Syno...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7015 CPD-7015] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7015 CPD-7015] == |
| − | * | + | * smiles: |
| − | ** | + | ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9)))) |
| + | * common name: | ||
| + | ** 71-hydroxychlorophyllide a | ||
| + | * molecular weight: | ||
| + | ** 628.966 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 7-hydroxychlorophyllide a (misleading) | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-7677]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-7676]] | |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657206 90657206] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16540 C16540] |
| + | {{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}} | ||
| + | {{#set: common name=71-hydroxychlorophyllide a}} | ||
| + | {{#set: molecular weight=628.966 }} | ||
| + | {{#set: common name=7-hydroxychlorophyllide a (misleading)}} | ||
| + | {{#set: consumed by=RXN-7677}} | ||
| + | {{#set: produced by=RXN-7676}} | ||
Latest revision as of 20:30, 21 March 2018
Contents
Metabolite CPD-7015
- smiles:
- C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
- common name:
- 71-hydroxychlorophyllide a
- molecular weight:
- 628.966
- Synonym(s):
- 7-hydroxychlorophyllide a (misleading)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.
