Difference between revisions of "Ec-22 000080"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] == * smiles: ** C(C(=O)C([O-])=O)C(C([O-])=O)O * inchi key: ** InChIKey=WX...")
 
(Created page with "Category:Gene == Gene Ec-22_000080 == * left end position: ** 101833 * transcription direction: ** NEGATIVE * right end position: ** 111058 * centisome position: ** 2.2550...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] ==
+
== Gene Ec-22_000080 ==
−
* smiles:
+
* left end position:
−
** C(C(=O)C([O-])=O)C(C([O-])=O)O
+
** 101833
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (4S)-4-hydroxy-2-oxoglutarate
+
** 111058
−
* molecular weight:
+
* centisome position:
−
** 160.083    
+
** 2.2550125    
 
* Synonym(s):
 
* Synonym(s):
−
** L-4-hydroxy-2-oxoglutarate
+
** Esi_0162_0001
−
** L-4-hydroxy-2-ketoglutarate
+
** Esi0162_0001
−
** (S)-2-hydroxy-4-oxopentanedioate
+
** TRE
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[TREHALA-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-13990]]
+
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY0-1182]]
 +
* [[PWY0-1466]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=101833}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70698337 70698337]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=111058}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71685 71685]
+
{{#set: centisome position=2.2550125   }}
−
* METABOLIGHTS : MTBLC71685
+
{{#set: common name=Esi_0162_0001|Esi0162_0001|TRE}}
−
{{#set: smiles=C(C(=O)C([O-])=O)C(C([O-])=O)O}}
+
{{#set: reaction associated=TREHALA-RXN}}
−
{{#set: inchi key=InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L}}
+
{{#set: pathway associated=PWY0-1182|PWY0-1466}}
−
{{#set: common name=(4S)-4-hydroxy-2-oxoglutarate}}
+
−
{{#set: molecular weight=160.083   }}
+
−
{{#set: common name=L-4-hydroxy-2-oxoglutarate|L-4-hydroxy-2-ketoglutarate|(S)-2-hydroxy-4-oxopentanedioate}}
+
−
{{#set: consumed or produced by=RXN-13990}}
+

Latest revision as of 19:30, 21 March 2018

Gene Ec-22_000080

  • left end position:
    • 101833
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 111058
  • centisome position:
    • 2.2550125
  • Synonym(s):
    • Esi_0162_0001
    • Esi0162_0001
    • TRE

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-22_000080&oldid=27399"