Difference between revisions of "Ec-22 000080"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] == * smiles: ** C(C(=O)C([O-])=O)C(C([O-])=O)O * inchi key: ** InChIKey=WX...") |
(Created page with "Category:Gene == Gene Ec-22_000080 == * left end position: ** 101833 * transcription direction: ** NEGATIVE * right end position: ** 111058 * centisome position: ** 2.2550...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-22_000080 == |
− | * | + | * left end position: |
− | ** | + | ** 101833 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 111058 |
− | * | + | * centisome position: |
− | ** | + | ** 2.2550125 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0162_0001 |
− | ** | + | ** Esi0162_0001 |
− | ** | + | ** TRE |
− | == | + | == Reactions associated == |
− | + | * Reaction: [[TREHALA-RXN]] | |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
+ | * [[PWY0-1182]] | ||
+ | * [[PWY0-1466]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=101833}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=111058}} | |
− | + | {{#set: centisome position=2.2550125 }} | |
− | + | {{#set: common name=Esi_0162_0001|Esi0162_0001|TRE}} | |
− | {{#set: | + | {{#set: reaction associated=TREHALA-RXN}} |
− | {{#set: | + | {{#set: pathway associated=PWY0-1182|PWY0-1466}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 20:30, 21 March 2018
Gene Ec-22_000080
- left end position:
- 101833
- transcription direction:
- NEGATIVE
- right end position:
- 111058
- centisome position:
- 2.2550125
- Synonym(s):
- Esi_0162_0001
- Esi0162_0001
- TRE
Reactions associated
- Reaction: TREHALA-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome