Difference between revisions of "Ec-19 003230"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15590 CPD-15590] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * inchi key: ** InChIKey=GZCGUP...")
 
(Created page with "Category:Gene == Gene Ec-19_003230 == * left end position: ** 3490370 * transcription direction: ** NEGATIVE * right end position: ** 3507598 * centisome position: ** 58.4...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15590 CPD-15590] ==
+
== Gene Ec-19_003230 ==
−
* smiles:
+
* left end position:
−
** [CH](=O)C(C(C(C(CO)O)O)O)O
+
** 3490370
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GZCGUPFRVQAUEE-KCDKBNATSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** aldehydo-D-galactose
+
** 3507598
−
* molecular weight:
+
* centisome position:
−
** 180.157    
+
** 58.458424    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0367_0023
 +
** Esi0367_0023
 +
** ACC
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-14409]]
+
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN0-5055]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY0-1264]]
 +
* [[PWY-7388]]
 +
* [[PWY-5789]]
 +
* [[PWY-5743]]
 +
* [[PWY-5744]]
 +
* [[PWY-6722]]
 +
* [[PWY-6679]]
 +
* [[PWY-4381]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: left end position=3490370}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01582 C01582]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=3507598}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17118 17118]
+
{{#set: centisome position=58.458424    }}
−
* PUBCHEM:
+
{{#set: common name=Esi_0367_0023|Esi0367_0023|ACC}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3037556 3037556]
+
{{#set: reaction associated=ACETYL-COA-CARBOXYLTRANSFER-RXN|RXN0-5055}}
−
{{#set: smiles=[CH](=O)C(C(C(C(CO)O)O)O)O}}
+
{{#set: pathway associated=PWY0-1264|PWY-7388|PWY-5789|PWY-5743|PWY-5744|PWY-6722|PWY-6679|PWY-4381}}
−
{{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-KCDKBNATSA-N}}
+
−
{{#set: common name=aldehydo-D-galactose}}
+
−
{{#set: molecular weight=180.157    }}
+
−
{{#set: consumed or produced by=RXN-14409}}
+

Latest revision as of 19:30, 21 March 2018

Gene Ec-19_003230

  • left end position:
    • 3490370
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3507598
  • centisome position:
    • 58.458424
  • Synonym(s):
    • Esi_0367_0023
    • Esi0367_0023
    • ACC

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-19_003230&oldid=27414"