Difference between revisions of "TRPSYN-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAMINE DOPAMINE] == * smiles: ** C(CC1(C=C(C(=CC=1)O)O))[N+] * inchi key: ** InChIKey=VYFYYTL...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=TRPSYN-PWY TRPSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TA...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=TRPSYN-PWY TRPSYN-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193] | ||
* common name: | * common name: | ||
− | ** | + | ** L-tryptophan biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''6''' reactions found over '''6''' reactions in the full pathway |
− | * [[ | + | * [[ANTHRANSYN-RXN]] |
− | * [[ | + | ** 1 associated gene(s): |
− | + | *** [[Ec-02_004370]] | |
− | == Reaction(s) | + | ** 2 reconstruction source(s) associated: |
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[IGPSYN-RXN]] | ||
+ | ** 5 associated gene(s): | ||
+ | *** [[Ec-08_003030]] | ||
+ | *** [[Ec-03_003850]] | ||
+ | *** [[Ec-11_002820]] | ||
+ | *** [[Ec-08_003020]] | ||
+ | *** [[Ec-27_004020]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[PRAISOM-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-08_003020]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[PRTRANS-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-01_003500]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[RXN0-2381]] | ||
+ | ** 8 associated gene(s): | ||
+ | *** [[Ec-27_001950]] | ||
+ | *** [[Ec-00_008830]] | ||
+ | *** [[Ec-24_002360]] | ||
+ | *** [[Ec-24_004010]] | ||
+ | *** [[Ec-20_002800]] | ||
+ | *** [[Ec-17_002680]] | ||
+ | *** [[Ec-01_012080]] | ||
+ | *** [[Ec-06_007490]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN0-2382]] | ||
+ | ** 8 associated gene(s): | ||
+ | *** [[Ec-20_002800]] | ||
+ | *** [[Ec-24_004010]] | ||
+ | *** [[Ec-06_007490]] | ||
+ | *** [[Ec-24_002360]] | ||
+ | *** [[Ec-17_002680]] | ||
+ | *** [[Ec-27_001950]] | ||
+ | *** [[Ec-01_012080]] | ||
+ | *** [[Ec-00_008830]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=TRPSYN-PWY TRPSYN-PWY] | |
− | + | * ARACYC: | |
− | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=TRPSYN-PWY TRPSYN-PWY] |
− | * | + | {{#set: taxonomic range=TAX-4751}} |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-2}} |
− | + | {{#set: taxonomic range=TAX-3193}} | |
− | + | {{#set: common name=L-tryptophan biosynthesis}} | |
− | + | {{#set: reaction found=6}} | |
− | + | {{#set: total reaction=6}} | |
− | + | {{#set: completion rate=100.0}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:02, 21 March 2018
Pathway TRPSYN-PWY
- taxonomic range:
- common name:
- L-tryptophan biosynthesis
- Synonym(s):
Reaction(s) found
6 reactions found over 6 reactions in the full pathway
- ANTHRANSYN-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- IGPSYN-RXN
- 5 associated gene(s):
- 2 reconstruction source(s) associated:
- PRAISOM-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- PRTRANS-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN0-2381
- 8 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN0-2382
- 8 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
- ARACYC: