Difference between revisions of "PWY-7614"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-237 CPD-237] == * smiles: ** C1(=C(CC(N)=O)C2(=CC=CC=C(N1)2)) * inchi key: ** InChIKey=ZOAM...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7614 PWY-7614] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40553 TAX-4...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7614 PWY-7614] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40553 TAX-40553] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** methiin metabolism |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''7''' reactions in the full pathway |
| − | == Reaction(s) | + | * [[RXN-8899]] |
| − | == | + | ** 0 associated gene: |
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16176 RXN-16176] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16199 RXN-16199] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16201 RXN-16201] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16202 RXN-16202] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16203 RXN-16203] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8908 RXN-8908] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-40553}} | |
| − | + | {{#set: common name=methiin metabolism}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=7}} | |
| − | + | {{#set: completion rate=14.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:31, 21 March 2018
Pathway PWY-7614
- taxonomic range:
- common name:
- methiin metabolism
- Synonym(s):
Reaction(s) found
1 reactions found over 7 reactions in the full pathway
- RXN-8899
- 0 associated gene:
- 1 reconstruction source(s) associated:
