Difference between revisions of "Ec-11 005650"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUMP DUMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-11_005650 == * left end position: ** 5616577 * transcription direction: ** POSITIVE * right end position: ** 5620810 * centisome position: ** 89.2...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-11_005650 == |
− | * | + | * left end position: |
− | ** | + | ** 5616577 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 5620810 |
− | * | + | * centisome position: |
− | ** | + | ** 89.29860 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0031_0050 |
− | ** | + | ** Esi0031_0050 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * | + | * Reaction: [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: go-term | |
− | * [[ | + | == Pathways associated == |
− | * | + | |
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5616577}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=5620810}} | |
− | + | {{#set: centisome position=89.29860 }} | |
− | + | {{#set: common name=Esi_0031_0050|Esi0031_0050}} | |
− | + | {{#set: reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:32, 21 March 2018
Gene Ec-11_005650
- left end position:
- 5616577
- transcription direction:
- POSITIVE
- right end position:
- 5620810
- centisome position:
- 89.29860
- Synonym(s):
- Esi_0031_0050
- Esi0031_0050
Reactions associated
- Reaction: NAD+-ADP-RIBOSYLTRANSFERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome