Difference between revisions of "Lipid-dihydrosterculate"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] == * smiles: ** C2(C=CC1(=C(C(O)=CN1)C=2)) * inchi key: ** InChIKey=PCKPVGOLPK...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lipid-dihydrosterculate Lipid-dihydrosterculate] == * common name: ** a [glycerolipid]-dihydros...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lipid-dihydrosterculate Lipid-dihydrosterculate] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a [glycerolipid]-dihydrosterculate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a [glycerolipid]-dihydrosterculic acid |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-7421]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | + | {{#set: common name=a [glycerolipid]-dihydrosterculate}} | |
− | + | {{#set: common name=a [glycerolipid]-dihydrosterculic acid}} | |
− | + | {{#set: produced by=RXN-7421}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:32, 21 March 2018
Contents
Metabolite Lipid-dihydrosterculate
- common name:
- a [glycerolipid]-dihydrosterculate
- Synonym(s):
- a [glycerolipid]-dihydrosterculic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [glycerolipid]-dihydrosterculate" cannot be used as a page name in this wiki.
"a [glycerolipid]-dihydrosterculic acid" cannot be used as a page name in this wiki.