Difference between revisions of "Lipid-dihydrosterculate"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] == * smiles: ** C2(C=CC1(=C(C(O)=CN1)C=2)) * inchi key: ** InChIKey=PCKPVGOLPK...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lipid-dihydrosterculate Lipid-dihydrosterculate] == * common name: ** a [glycerolipid]-dihydros...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lipid-dihydrosterculate Lipid-dihydrosterculate] ==
* smiles:
+
** C2(C=CC1(=C(C(O)=CN1)C=2))
+
* inchi key:
+
** InChIKey=PCKPVGOLPKLUHR-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** indoxyl
+
** a [glycerolipid]-dihydrosterculate
* molecular weight:
+
** 133.149   
+
 
* Synonym(s):
 
* Synonym(s):
** indole-3-ol
+
** a [glycerolipid]-dihydrosterculic acid
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-7421]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-15587]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a [glycerolipid]-dihydrosterculate}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50591 50591]
+
{{#set: common name=a [glycerolipid]-dihydrosterculic acid}}
* CHEMSPIDER:
+
{{#set: produced by=RXN-7421}}
** [http://www.chemspider.com/Chemical-Structure.45861.html 45861]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17840 17840]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C05658 C05658]
+
* HMDB : HMDB04094
+
{{#set: smiles=C2(C=CC1(=C(C(O)=CN1)C=2))}}
+
{{#set: inchi key=InChIKey=PCKPVGOLPKLUHR-UHFFFAOYSA-N}}
+
{{#set: common name=indoxyl}}
+
{{#set: molecular weight=133.149    }}
+
{{#set: common name=indole-3-ol}}
+
{{#set: consumed or produced by=RXN-15587}}
+

Latest revision as of 19:32, 21 March 2018

Metabolite Lipid-dihydrosterculate

  • common name:
    • a [glycerolipid]-dihydrosterculate
  • Synonym(s):
    • a [glycerolipid]-dihydrosterculic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [glycerolipid]-dihydrosterculate" cannot be used as a page name in this wiki.
"a [glycerolipid]-dihydrosterculic acid" cannot be used as a page name in this wiki.