Difference between revisions of "FORMYLTHFDEFORMYL-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13122 CPD-13122] == * smiles: ** C(C1(OC(C(C(C=1)O)O)O))([O-])=O * inchi key: ** InChIKey=I...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FORMYLTHFDEFORMYL-RXN FORMYLTHFDEFORMYL-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FORMYLTHFDEFORMYL-RXN FORMYLTHFDEFORMYL-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/3.5.1.10 EC-3.5.1.10] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[FORMYL-THF-GLU-N]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[FORMATE]][c] '''+''' 1 [[THF-GLU-N]][c] |
− | * [[ | + | * With common name(s): |
− | + | ** 1 an N10-formyl-tetrahydrofolate[c] '''+''' 1 H2O[c] '''=>''' 1 H+[c] '''+''' 1 formate[c] '''+''' 1 a tetrahydrofolate[c] | |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWY-2201]], folate transformations I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2201 PWY-2201] | ||
+ | ** '''12''' reactions found over '''12''' reactions in the full pathway | ||
+ | * [[P164-PWY]], purine nucleobases degradation I (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=P164-PWY P164-PWY] | ||
+ | ** '''4''' reactions found over '''17''' reactions in the full pathway | ||
+ | * [[PWY-5497]], purine nucleobases degradation II (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5497 PWY-5497] | ||
+ | ** '''8''' reactions found over '''24''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19833 19833] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00944 R00944] |
− | + | * UNIPROT: | |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P37051 P37051] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q03432 Q03432] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9PPC9 Q9PPC9] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q46339 Q46339] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9X7F7 Q9X7F7] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
+ | {{#set: ec number=EC-3.5.1.10}} | ||
+ | {{#set: in pathway=PWY-2201|P164-PWY|PWY-5497}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:02, 21 March 2018
Contents
Reaction FORMYLTHFDEFORMYL-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 FORMYL-THF-GLU-N[c] + 1 WATER[c] => 1 PROTON[c] + 1 FORMATE[c] + 1 THF-GLU-N[c]
- With common name(s):
- 1 an N10-formyl-tetrahydrofolate[c] + 1 H2O[c] => 1 H+[c] + 1 formate[c] + 1 a tetrahydrofolate[c]
Genes associated with this reaction
Pathways
- PWY-2201, folate transformations I: PWY-2201
- 12 reactions found over 12 reactions in the full pathway
- P164-PWY, purine nucleobases degradation I (anaerobic): P164-PWY
- 4 reactions found over 17 reactions in the full pathway
- PWY-5497, purine nucleobases degradation II (anaerobic): PWY-5497
- 8 reactions found over 24 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links