Difference between revisions of "Ec-12 003120"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE INDOLE] == * smiles: ** C2(C=CC1(=C(C=CN1)C=2)) * inchi key: ** InChIKey=SIKJAQJRHWYJAI-...")
 
(Created page with "Category:Gene == Gene Ec-12_003120 == * Synonym(s): ** Esi_0264_0036 ** Esi0264_0036 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE INDOLE] ==
+
== Gene Ec-12_003120 ==
* smiles:
+
** C2(C=CC1(=C(C=CN1)C=2))
+
* inchi key:
+
** InChIKey=SIKJAQJRHWYJAI-UHFFFAOYSA-N
+
* common name:
+
** indole
+
* molecular weight:
+
** 117.15   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0264_0036
 +
** Esi0264_0036
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN0-2382]]
+
* Reaction: [[RXN-8443]]
* [[INDOLE-23-DIOXYGENASE-RXN]]
+
** Source: [[orthology-aragem]]
== Reaction(s) known to produce the compound ==
+
== Pathways associated ==
== Reaction(s) of unknown directionality ==
+
* [[PWY-5381]]
* [[RXN0-2381]]
+
 
== External links  ==
 
== External links  ==
* CAS : 120-72-9
+
{{#set: common name=Esi_0264_0036|Esi0264_0036}}
* DRUGBANK : DB04532
+
{{#set: reaction associated=RXN-8443}}
* PUBCHEM:
+
{{#set: pathway associated=PWY-5381}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=798 798]
+
* HMDB : HMDB00738
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00463 C00463]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.776.html 776]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16881 16881]
+
* BIGG : 35045
+
{{#set: smiles=C2(C=CC1(=C(C=CN1)C=2))}}
+
{{#set: inchi key=InChIKey=SIKJAQJRHWYJAI-UHFFFAOYSA-N}}
+
{{#set: common name=indole}}
+
{{#set: molecular weight=117.15    }}
+
{{#set: consumed by=RXN0-2382|INDOLE-23-DIOXYGENASE-RXN}}
+
{{#set: consumed or produced by=RXN0-2381}}
+

Latest revision as of 19:32, 21 March 2018

Gene Ec-12_003120

  • Synonym(s):
    • Esi_0264_0036
    • Esi0264_0036

Reactions associated

Pathways associated

External links