Difference between revisions of "CPD-9852"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7725 PWY-7725] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9852 CPD-9852] == * smiles: ** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9852 CPD-9852] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C |
| + | * inchi key: | ||
| + | ** InChIKey=PEMFGDIFKKXFRG-PYHSYOTJSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-heptaprenyl-4-hydroxybenzoate |
| + | * molecular weight: | ||
| + | ** 613.942 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-9222]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54740346 54740346] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84496 84496] |
| + | {{#set: smiles=CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C}} | ||
| + | {{#set: inchi key=InChIKey=PEMFGDIFKKXFRG-PYHSYOTJSA-M}} | ||
| + | {{#set: common name=3-heptaprenyl-4-hydroxybenzoate}} | ||
| + | {{#set: molecular weight=613.942 }} | ||
| + | {{#set: produced by=RXN-9222}} | ||
Latest revision as of 19:32, 21 March 2018
Contents
Metabolite CPD-9852
- smiles:
- CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C
- inchi key:
- InChIKey=PEMFGDIFKKXFRG-PYHSYOTJSA-M
- common name:
- 3-heptaprenyl-4-hydroxybenzoate
- molecular weight:
- 613.942
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C" cannot be used as a page name in this wiki.
