Difference between revisions of "MPBQ"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5525 PWY-5525] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-77...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(C=C(C)C=1O)O))C)C * inchi key: ** In...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] == |
− | * | + | * smiles: |
− | ** | + | ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(C=C(C)C=1O)O))C)C |
+ | * inchi key: | ||
+ | ** InChIKey=GTWCNYRFOZKWTL-UOFXASEASA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 2-methyl-6-phytyl-1,4-benzoquinol |
+ | * molecular weight: | ||
+ | ** 402.659 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-2542]] |
− | + | * [[RXN-2561]] | |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-2541]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15882 C15882] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75920 75920] |
− | {{#set: | + | * METABOLIGHTS : MTBLC75920 |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71768135 71768135] | ||
+ | * HMDB : HMDB38959 | ||
+ | {{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(C=C(C)C=1O)O))C)C}} | ||
+ | {{#set: inchi key=InChIKey=GTWCNYRFOZKWTL-UOFXASEASA-N}} | ||
+ | {{#set: common name=2-methyl-6-phytyl-1,4-benzoquinol}} | ||
+ | {{#set: molecular weight=402.659 }} | ||
+ | {{#set: consumed by=RXN-2542|RXN-2561}} | ||
+ | {{#set: produced by=RXN-2541}} |
Latest revision as of 19:32, 21 March 2018
Contents
Metabolite MPBQ
- smiles:
- CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(C=C(C)C=1O)O))C)C
- inchi key:
- InChIKey=GTWCNYRFOZKWTL-UOFXASEASA-N
- common name:
- 2-methyl-6-phytyl-1,4-benzoquinol
- molecular weight:
- 402.659
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links